| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | BCI-137
(BCI137) Basic information |
| Product Name: | BCI-137
(BCI137) | | Synonyms: | BCI-137
(BCI137);2-(2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonamido)propanoic acid;Alanine, N-[(1,2,3,4-tetrahydro-2,3-dioxo-6-quinoxalinyl)sulfonyl]-;((2,3-Dioxo-1,2,3,4-tetrahydroquinoxalin-6-yl)sulfonyl)alanine;BCI-137, 10 mM in DMSO;Argonaute-2 Inhibitor, BCI-137 | | CAS: | 112170-24-8 | | MF: | C11H11N3O6S | | MW: | 313.29 | | EINECS: | | | Product Categories: | | | Mol File: | 112170-24-8.mol |  |
| | BCI-137
(BCI137) Chemical Properties |
| density | 1.566±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 100mg/mL | | form | Solid | | pka | 3.30±0.10(Predicted) | | color | White to off-white | | SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC2=C(C=C1)NC(=O)C(=O)N2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | BCI-137
(BCI137) Usage And Synthesis |
| Description | BCI-137 is an Argonaute 2 (Ago2) ligand that acts by targeting the MicroRNA Binding Domain. | | Uses | BCI-137 is a competitive AGO2 inhibitor, with an IC50 of 342 μM. BCI-137 tightly binds to several residues of the Mid domain[1]. | | References | [1] Poser E, et, al. Surface Plasmon Resonance: A Useful Strategy for the Identification of Small Molecule Argonaute 2 Protein Binders. Methods Mol Biol. 2017;1517:223-237. DOI:10.1007/978-1-4939-6563-2_16 |
| | BCI-137
(BCI137) Preparation Products And Raw materials |
|