- Fmoc-amino-PEG5-acid
-
- $0.00 / 100mg
-
2026-01-04
- CAS:882847-32-7
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | FMOC-18-AMINO-4,7,10,13,16-PENTAOXAOCTADECANOIC ACID Basic information |
| Product Name: | FMOC-18-AMINO-4,7,10,13,16-PENTAOXAOCTADECANOIC ACID | | Synonyms: | FMoc-NH-PEG5-CH2CH2COOH;5,8,11,14,17-Pentaoxa-2-azaeicosanedioic acid 1-(9H-fluoren-9-ylmethyl) ester;FMOC-18-AMINO-4,7,10,13,16-PENTAOXAOCTADECANOIC ACID;Fmoc-PEG5-propionic acid;1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19-hexaoxa-4-azadocosan-22-oic acid;Fmoc-N-amido-PEG5-acid;Fmoc-PEG5-CH2CH2COOH;Fmoc-NH-PEG5-COOH | | CAS: | 882847-32-7 | | MF: | C28H37NO9 | | MW: | 531.59 | | EINECS: | | | Product Categories: | amino acid;peg | | Mol File: | 882847-32-7.mol |  |
| | FMOC-18-AMINO-4,7,10,13,16-PENTAOXAOCTADECANOIC ACID Chemical Properties |
| Boiling point | 711.4±60.0 °C(Predicted) | | density | 1.210±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | pka | 4.28±0.10(Predicted) | | form | Liquid | | color | Colorless to light yellow | | Major Application | peptide synthesis | | InChIKey | TWQTXZPTZPOEEB-UHFFFAOYSA-N | | SMILES | N(CCOCCOCCOCCOCCOCCC(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| WGK Germany | WGK 2 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | FMOC-18-AMINO-4,7,10,13,16-PENTAOXAOCTADECANOIC ACID Usage And Synthesis |
| Description | Fmoc-N-amido-PEG5-acid is a PEG linker containing an Fmoc-protected amine and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Chemical Properties | Yellow oil | | Uses | Fmoc-amino-PEG5-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | reaction suitability | reaction type: Pegylations | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | FMOC-18-AMINO-4,7,10,13,16-PENTAOXAOCTADECANOIC ACID Preparation Products And Raw materials |
|