1,3-DI-TERT-BUTYLBENZENE manufacturers
|
| | 1,3-DI-TERT-BUTYLBENZENE Basic information |
| Product Name: | 1,3-DI-TERT-BUTYLBENZENE | | Synonyms: | 1,3-bis-(1,1-dimethylethyl)-benzene;1,3-bis(1,1-dimethylethyl)benzene;1,3-tert-dibutylbenzene;Benzene, m-di-tert-butyl-;m-Di-tert-butylbenzene;1,3-DI-TERT-BUTYLBENZENE;1,3-DI-TERT-BUTYLBENZENE 99%;1,3-Di-t-butylbenzene | | CAS: | 1014-60-4 | | MF: | C14H22 | | MW: | 190.32 | | EINECS: | | | Product Categories: | Arenes;Building Blocks;Organic Building Blocks | | Mol File: | 1014-60-4.mol |  |
| | 1,3-DI-TERT-BUTYLBENZENE Chemical Properties |
| Melting point | 10-11 °C (lit.) | | Boiling point | 106-107 °C/18 mmHg (lit.) | | density | 0.859 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.488(lit.) | | Fp | 183 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | Insoluble in water. | | InChI | 1S/C14H22/c1-13(2,3)11-8-7-9-12(10-11)14(4,5)6/h7-10H,1-6H3 | | InChIKey | ILNDSSCEZZFNGE-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1cccc(c1)C(C)(C)C | | CAS DataBase Reference | 1014-60-4(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2902.90.9000 | | Storage Class | 10 - Combustible liquids |
| | 1,3-DI-TERT-BUTYLBENZENE Usage And Synthesis |
| Uses | 1,3-Di-tert-butylbenzene is used as a pharmaceutical intermediate. | | Definition | ChEBI: 1,3-Di-tert-butylbenzene is an alkylbenzene. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 52, p. 1222, 1987 DOI: 10.1021/jo00383a009 | | General Description | The solute-solvent nuclear overhauser effects (NOEs) of 1,3-di-tert-butylbenzene was studied in solvents composed of tetramethylsilane, perfluoro-tert-butyl alcohol and carbon tetrachloride. |
| | 1,3-DI-TERT-BUTYLBENZENE Preparation Products And Raw materials |
| Raw materials | 3,5-Di-tert-butylbromobenzene-->3,5-ditert-butylphenyl 4-methylbenzenesulfonate-->1,4-Di-tert-butylbenzene-->Benzene, 1,3-bis(1,1-dimethylethyl)-5-iodo-
-->3,5-DI-TERT-BUTYLPHENOL-->Acetic acid-->Trimethylaluminium | | Preparation Products | 1,4-Di-tert-butylbenzene-->2,6-Di-tert-butylphenol-->1-Bromo-4-tert-butylbenzene-->5-amino-2,4-ditert-butylphenylamine |
|