| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Hydroxymidazolam Basic information |
| Product Name: | 4-Hydroxymidazolam | | Synonyms: | 8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-4-o;8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-4-ol;8-Chloro-6-(2-fluorophenyl)-4-hydroxy-4H-imidazo[1,5a][1,4]bezodiazepine;4-Hydroxymidazolam,8-Chloro-6-(2-fluorophenyl)-4-hydroxy-4H-imidazo[1,5a][1,4]bezodiazepine;4H-Imidazo[1,5-a][1,4]benzodiazepin-4-ol, 8-chloro-6-(2-fluorophenyl)-1-methyl-;8-chloro-6-(2-fluorophenyl)-1-methyl-4H-benzo[f]imidazo[1,5-a][1,4]diazepin-4-ol;4-Hydroxy MidazolamQ: What is
4-Hydroxy Midazolam Q: What is the CAS Number of
4-Hydroxy Midazolam Q: What is the storage condition of
4-Hydroxy Midazolam;4-Hydroxymidazolam solution | | CAS: | 59468-85-8 | | MF: | C18H13ClFN3O | | MW: | 341.77 | | EINECS: | 200-323-9 | | Product Categories: | Pharmaceuticals;Metabolites & Impurities;Intermediates & Fine Chemicals;Intermediates;Heterocycles;Aromatics | | Mol File: | 59468-85-8.mol |  |
| | 4-Hydroxymidazolam Chemical Properties |
| Melting point | 186-187 °C | | Boiling point | 550.6±60.0 °C(Predicted) | | density | 1.44±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.69±0.40(Predicted) | | color | white to off-white | | InChI | 1S/C18H13ClFN3O/c1-10-21-9-16-18(24)22-17(12-4-2-3-5-14(12)20)13-8-11(19)6-7-15(13)23(10)16/h2-9,18,24H,1H3 | | InChIKey | ZYISITHKPKHPKG-UHFFFAOYSA-N | | SMILES | FC(C=CC=C1)=C1C2=NC(O)C3=CN=C(C)N3C4=C2C=C(Cl)C=C4 | | CAS DataBase Reference | 59468-85-8 |
| WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4-Hydroxymidazolam Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A metabolite of Midazolam (M343000). | | Uses | 4′-Hydroxymidazolam can be used in cell biology studies. It can also be used for studying cell signaling and neuroscience. | | Definition | ChEBI: 4-hydroxymidazolam is an imidazobenzodiazepine that is midazolam which is substituted by a hydroxy group at position 4. It is the minor hydroxylated metabolite of the anesthetic, midazolam. It has a role as a drug metabolite, a human blood serum metabolite and a human urinary metabolite. It is an imidazobenzodiazepine, a member of monofluorobenzenes, an organochlorine compound and an organic hydroxy compound. It is functionally related to a midazolam. | | Biochem/physiol Actions | 4′-Hydroxymidazolam is the minor hydroxylated metabolite of Midazolam (MDZ). The product contributes in the pharmacological impact of MDZ. |
| | 4-Hydroxymidazolam Preparation Products And Raw materials |
|