| Company Name: |
Beijing Yan Nuo XinCheng Chemical Co., Ltd.
|
| Tel: |
86-10-82830276 |
| Email: |
|
| Products Intro: |
Product Name:5,5'''''-dihexyl-2,2':5',2'':5'',2''':5''',2'''':5'''',2'''''-sexithiophene CAS:151271-43-1 Purity:SubliMed >99% Package:1g;10g;100g;1kg
|
| Company Name: |
Derthon Optoelectronic Materials Sci. Tech. Co., Ltd.
|
| Tel: |
0755-26718755 13266723223 |
| Email: |
sales@derthon.com |
| Products Intro: |
Product Name:2-hexyl-5-[5-[5-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene CAS:151271-43-1 Purity:97% Package:1g,5g,10g,100g Remarks:g\kg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:5,5'''''-Dihexyl-2,2':5',2'':5'',2''':5''',2'''':5'''',2'''''-sexithiophene CAS:151271-43-1 Purity:electron donor for OPV devices Package:500MG Remarks:633216-500MG
|
|
| | 5 5''''-DIHEXYL-2 2':5' 2'':5'' 2''':5'& Basic information |
| Product Name: | 5 5''''-DIHEXYL-2 2':5' 2'':5'' 2''':5'& | | Synonyms: | Α,Ω-DH6T;5,5'''''-Dihexyl-2,2':5',2'':5'',2''':5''',2'''':5'''',2'''''-sexithiophene electron donor for OPV devices;5 5''''-DIHEXYL-2 2':5' 2'':5'' 2''':5'&;5,5''''-dihexyl-2,2':5',2'':5'',2''':5''',2'''':5'''',2'''''-sexithiophene;α,ω-dihexylsexithiophene;α,ω-Dihexylsexithiophene, DH-6T;2,2':5',2'':5'',2''':5''',2'''':5'''',2'''''-Sexithiophene, 5,5'''''-dihexyl-;2-hexyl-5-[5-[5-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene | | CAS: | 151271-43-1 | | MF: | C36H38S6 | | MW: | 663.08 | | EINECS: | | | Product Categories: | | | Mol File: | 151271-43-1.mol |  |
| | 5 5''''-DIHEXYL-2 2':5' 2'':5'' 2''':5'& Chemical Properties |
| Melting point | 280 °C (dec.)(lit.) | | Boiling point | 700.9±55.0 °C(Predicted) | | density | 1.204±0.06 g/cm3(Predicted) | | solubility | chlorobenzene: solublesoluble | | form | solid | | semiconductor properties | P-type (mobility=0.13cm2/V·s) | | InChIKey | QCMASTUHHXPVGT-UHFFFAOYSA-N | | SMILES | CCCCCCc1ccc(s1)-c2ccc(s2)-c3ccc(s3)-c4ccc(s4)-c5ccc(s5)-c6ccc(CCCCCC)s6 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 5 5''''-DIHEXYL-2 2':5' 2'':5'' 2''':5'& Usage And Synthesis |
| Uses | DH6T can be used as a p-type donor molecule for the fabrication of organic electronic devices such as organic field effect transistors (OFETs), thin film transistors (TFTs) and organic solar cells (OSCs). | | General Description | 5,5′′′′′-Dihexyl-2,2′:5′,2′′:5′′,2′′′:5′′′,2′′′′:5′′′′,2′′′′′-sexithiophene (DH6T) is an alkyl substituted oligothiophene that can be used as an organic semiconductor. It has a field mobility of 1 cm2/Vs that makes it a suitable active layered material in electronic and optoelectronic applications. |
| | 5 5''''-DIHEXYL-2 2':5' 2'':5'' 2''':5'& Preparation Products And Raw materials |
|