- D-2-Aminoadipic acid
-
- $0.00 / 1KG
-
2026-04-17
- CAS:7620-28-2
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 50kg/month
- D-2-Aminoadipic acid
-
- $0.00 / 1Kg
-
2024-12-24
- CAS:7620-28-2
- Min. Order: 1Kg
- Purity: 99.9%
- Supply Ability: 200tons
- D-2-Aminoadipic acid
-
- $15.00 / 1KG
-
2021-08-12
- CAS:7620-28-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | D-2-Aminoadipic acid Basic information |
| | D-2-Aminoadipic acid Chemical Properties |
| Melting point | 208-210 °C(lit.) | | alpha | -24 º (c=1, 6N HCl) | | Boiling point | 364.0±32.0 °C(Predicted) | | density | 1.333±0.06 g/cm3(Predicted) | | refractive index | -24 ° (C=1, 6mol/L HCl) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.49±0.24(Predicted) | | form | Powder or Crystalline Powder | | color | White to off-white | | Optical Rotation | Consistent with structure | | BRN | 1724347 | | InChI | InChI=1S/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)/t4-/m1/s1 | | InChIKey | OYIFNHCXNCRBQI-SCSAIBSYSA-N | | SMILES | C(O)(=O)[C@H](N)CCCC(O)=O | | CAS DataBase Reference | 7620-28-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | D-2-Aminoadipic acid Usage And Synthesis |
| Chemical Properties | Solid | | Uses | D-2-Aminoadipic Acid is a glutamine synthetase inhibitor. | | Definition | ChEBI: An optically active form of 2-aminoadipic acid having D-configuration. | | Biological Activity | D-2-Aminoadipic acid is a glutamate analog. It acts as an inhibitor of glutamate synthetase. D-2-Aminoadipic acid exhibits gliotoxicity towards mitotic astrocytes. |
| | D-2-Aminoadipic acid Preparation Products And Raw materials |
|