| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (-)-(S)-Aminoglutethimide 97 Basic information |
| | (-)-(S)-Aminoglutethimide 97 Chemical Properties |
| Melting point | 115.5-119.5 °C (lit.) | | Boiling point | 457.4±45.0 °C(Predicted) | | density | 1.173±0.06 g/cm3(Predicted) | | pka | 11.60±0.40(Predicted) | | Optical Rotation | [α]20/D 160°, c = 1 in methanol | | InChI | 1S/C13H16N2O2/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/h3-6H,2,7-8,14H2,1H3,(H,15,16,17)/t13-/m0/s1 | | InChIKey | ROBVIMPUHSLWNV-ZDUSSCGKSA-N | | SMILES | CC[C@]1(CCC(=O)NC1=O)c2ccc(N)cc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (-)-(S)-Aminoglutethimide 97 Usage And Synthesis |
| Uses | (S)-()-Aminoglutethimide can be used:
- As an internal standard in the separation of the pyridoglutethimide enantiomers using the HPLC technique.
- In the study of steroid hormones role on human cytomegalovirus replication in adrenocortical cells.
| | Definition | ChEBI: (S)-aminoglutethimide is the (3R)-enantiomer of aminoglutethimide. It is an enantiomer of a (R)-aminoglutethimide. |
| | (-)-(S)-Aminoglutethimide 97 Preparation Products And Raw materials |
|