| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 3-Amino-2-benzoyl-6-nitrobenzofuran Basic information |
| Product Name: | 3-Amino-2-benzoyl-6-nitrobenzofuran | | Synonyms: | JR-8123, (3-Amino-6-nitrobenzofuran-2-yl)(phenyl)methanone, 97%;3-Amino-2-benzoyl-6-nitrobenzofuran 97%;Methanone, (3-amino-6-nitro-2-benzofuranyl)phenyl-;3-AMINO-2-BENZOYL-6-NITROBENZOFURAN | | CAS: | 351003-27-5 | | MF: | C15H10N2O4 | | MW: | 282.25 | | EINECS: | | | Product Categories: | | | Mol File: | 351003-27-5.mol |  |
| | 3-Amino-2-benzoyl-6-nitrobenzofuran Chemical Properties |
| Melting point | 230-234 °C(lit.) | | InChI | 1S/C15H10N2O4/c16-13-11-7-6-10(17(19)20)8-12(11)21-15(13)14(18)9-4-2-1-3-5-9/h1-8H,16H2 | | InChIKey | VBCOORLNGQAWSF-UHFFFAOYSA-N | | SMILES | Nc1c(oc2cc(ccc12)[N+]([O-])=O)C(=O)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Amino-2-benzoyl-6-nitrobenzofuran Usage And Synthesis |
| | 3-Amino-2-benzoyl-6-nitrobenzofuran Preparation Products And Raw materials |
|