| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2 7-Di(tert-butyl)-9-fluorenylmethyl Basic information |
| | 2 7-Di(tert-butyl)-9-fluorenylmethyl Chemical Properties |
| Melting point | 66-70 °C(lit.) | | Boiling point | 447.8±14.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | 1S/C23H27ClO2/c1-22(2,3)14-7-9-16-17-10-8-15(23(4,5)6)12-19(17)20(18(16)11-14)13-26-21(24)25/h7-12,20H,13H2,1-6H3 | | InChIKey | PHUMWWRUIGKGNN-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1ccc-2c(c1)C(COC(Cl)=O)c3cc(ccc-23)C(C)(C)C |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2 7-Di(tert-butyl)-9-fluorenylmethyl Usage And Synthesis |
| Uses | 2,7-Di-tert-butyl-9-fluorenylmethyl chloroformate may be used in the preparation of polymer-supported (2,7-di-tert-butyl-9-fluorenyl)methyl succinimidyl carbonate (Dtb-Fmoc-P-OSu), a polymeric reagent for protecting amino groups. | | General Description | 2,7-Di-tert-butyl-9-fluorenylmethyl chloroformate contains 2,7-di-tert-butyl-Fmoc protecting group (Fmoc= fluorenylmethoxycarbonyl), which is more soluble in organic solvents when compared to its Fmoc analog. It can be prepared from fluorene in three steps, by di-tert-butylation, hydroxymethylation and phosgenation. |
| | 2 7-Di(tert-butyl)-9-fluorenylmethyl Preparation Products And Raw materials |
|