| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Disperse Red 1 methacrylate CAS:103553-48-6 Purity:95% Package:1G Remarks:570419-1G
|
| Company Name: |
Zhengzhou Gecko Scientific Inc.
|
| Tel: |
0371-63336364 17344886665 |
| Email: |
209932355@qq.com |
| Products Intro: |
Product Name:DISPERSE RED 1 METHACRYLATE CAS:103553-48-6 Purity:97% Package:1g;10g;100g
|
| Company Name: |
MQ (shanghai) Pharmaceuticals Co., Ltd.
|
| Tel: |
13761635123 |
| Email: |
sales@linyuepharm.com |
| Products Intro: |
Product Name:DISPERSE RED 1 METHACRYLATE 95 CAS:103553-48-6 Purity:>95% Package:1G,5G
|
| Company Name: |
Jinan ponder chemical co. LTD
|
| Tel: |
0531-0000 |
| Email: |
thinklifescience@163.com |
| Products Intro: |
Product Name:103553-48-6 CAS:103553-48-6 Purity:99% HPLC Package:1KG;500G;100G;50G;1G
|
|
| | DISPERSE RED 1 METHACRYLATE 95 Basic information |
| | DISPERSE RED 1 METHACRYLATE 95 Chemical Properties |
| Melting point | 78-83 °C(lit.) | | Boiling point | 549.0±45.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.15±0.50(Predicted) | | form | solid | | λmax | 493 nm | | InChI | 1S/C20H22N4O4/c1-4-23(13-14-28-20(25)15(2)3)18-9-5-16(6-10-18)21-22-17-7-11-19(12-8-17)24(26)27/h5-12H,2,4,13-14H2,1,3H3/b22-21+ | | InChIKey | MHYWMAUCJNDHPY-QURGRASLSA-N | | SMILES | CCN(CCOC(=O)C(C)=C)c1ccc(cc1)\N=N\c2ccc(cc2)[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-28-36/37 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | DISPERSE RED 1 METHACRYLATE 95 Usage And Synthesis |
| General Description | NLO material |
| | DISPERSE RED 1 METHACRYLATE 95 Preparation Products And Raw materials |
|