- 1,3,5-Tris(bromomethyl)benzene
-
- $100.00 / 1KG
-
2025-09-25
- CAS:18226-42-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1,3,5-Tris(bromomethyl)benzene Basic information |
| Product Name: | 1,3,5-Tris(bromomethyl)benzene | | Synonyms: | 1,3,5-(TribroMoMethyl)benzene;1 3 5-TRIS(BROMOMETHYL)BENZENE 97;Benzene, 1,3,5-tris(bromomethyl)-;1,3,5-TRIS(BROMOMETHYL)BENZENE,98%;1,3,5-Tris(bromomethyl)benzene;1,3,5-Tris(bromometh;1,3,5-Tris(broMoMethyl)benzene 97%;alpha,alpha',alpha''-Tribromomesitylene | | CAS: | 18226-42-1 | | MF: | C9H9Br3 | | MW: | 356.88 | | EINECS: | | | Product Categories: | Organic Electronics and Photonics;Synthetic Intermediates;Synthetic Tools and Reagents | | Mol File: | 18226-42-1.mol |  |
| | 1,3,5-Tris(bromomethyl)benzene Chemical Properties |
| Melting point | 94-99 °C | | Boiling point | 352.2±37.0 °C(Predicted) | | density | 2.005±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C9H9Br3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1-3H,4-6H2 | | InChIKey | GHITVUOBZBZMND-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC(CBr)=CC(CBr)=C1 | | CAS DataBase Reference | 18226-42-1(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 1,3,5-Tris(bromomethyl)benzene Usage And Synthesis |
| Uses | 1,3,5-Tris(bromomethyl)benzene can be used to treat bacterial infections and potentiation of antibiotics. | | General Description | 1,3,5-Tris(bromomethyl)benzene has three bromo substituents around an aromatic ring that can be used as a cross-linker. It is mainly utilized in the synthesis of ligands and dendrimeric monomers. |
| | 1,3,5-Tris(bromomethyl)benzene Preparation Products And Raw materials |
| Raw materials | 1,3-Benzenedicarboxylic acid, 5-(methoxymethyl)-, 1,3-dimethyl ester-->Benzenemethanol, 3,5-bis(bromomethyl)--->Trimesic acid-->3,5-Bis(bromomethyl)toluene-->5-METHYLISOPTHALIC ACID DIMETHYLESTER-->1,3,5-Benzenetricarboxylic acid chloride-->1,3,5-BENZENETRIMETHANOL-->TRIMETHYL 1,3,5-BENZENETRICARBOXYLATE-->Triethyl 1,3,5-benzenetricarboxylate-->Mesitylene-->Dimethyl 5-(bromomethyl)isophthalate-->Propargyl bromide | | Preparation Products | 3,5-Bis(bromomethyl)toluene |
|