|
|
| | YTTERBIUM(III) TRIFLATE HYDRATE, 99.90% Basic information |
| Product Name: | YTTERBIUM(III) TRIFLATE HYDRATE, 99.90% | | Synonyms: | Ytterbium(III) trifluoromethanesulphonate hydrate 95+%;fonate hydrate;Ytterbium(III) trifL;YTTERBIUM(III) TRIFLUOROMETHANESULFONATE, YB 25-28% APPROX.;Trifluoromethanesulfonic acid ytterbium salt, Ytterbium(III) triflate;Ytterbium(III) triflate hydrate,99.9%;Ytterbium(III) triflate hydrateYtterbium(III) trifluoromethanesulfonate;YtterbiuM(III) triflate hydrate, 99.9%, (trace Metal basis) | | CAS: | 252976-51-5 | | MF: | C3H2F9O10S3Yb | | MW: | 638.2626088 | | EINECS: | | | Product Categories: | triflate | | Mol File: | 252976-51-5.mol |  |
| | YTTERBIUM(III) TRIFLATE HYDRATE, 99.90% Chemical Properties |
| Melting point | 118-122° | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | White | | Water Solubility | Insoluble in water. | | Stability: | hygroscopic | | InChI | 1S/3CHF3O3S.H2O.Yb/c3*2-1(3,4)8(5,6)7;;/h3*(H,5,6,7);1H2;/q;;;;+3/p-3 | | InChIKey | BUJKNFNMGRYZBV-UHFFFAOYSA-K | | SMILES | [H]O[H].FC(F)(F)S(=O)(=O)O[Yb](OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F | | CAS DataBase Reference | 252976-51-5 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | HS Code | 28469000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | YTTERBIUM(III) TRIFLATE HYDRATE, 99.90% Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Ytterbium(III) trifluoromethanesulfonate hydrate is used to promote glycosidation of glycosyl fluorides and as a catalyst in the preparation of pyridine and quinoline derivatives. | | General Description | Layer-by-layer assembly of 4-aminothiophenol and ytterbium(III)trifluoromethanesulfonate hydrate film has been investigated by atomic force microscopy (AFM). Bis(oxazolinyl)-pyridine-scandium(III) triflate complexes have been reported to catalyze the enantioselective Friedel-Crafts addition of various indoles. | | reaction suitability | core: ytterbium reagent type: catalyst |
| | YTTERBIUM(III) TRIFLATE HYDRATE, 99.90% Preparation Products And Raw materials |
|