| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(+)-alpha-Terpineol
CAS:7785-53-7
|
|
| | (+)-ALPHA-TERPINEOL Basic information |
| Product Name: | (+)-ALPHA-TERPINEOL | | Synonyms: | (R)-(+)-α-terpineol;(R)-(+)-alpha-terpineol;.alpha.,.alpha.-4-trimethyl-,(R)-3-Cyclohexene-1-methanol;alpha,4-trimethyl-alph(theta)-3-cyclohexene-1-methano;(R)-alpha,alpha,4-trimethylcyclohex-3-ene-1-methanol;(R)-alpha,alpha,4-Trimethylcyclohex-3-en-1-methanol;TERPINEOL-RECHTS-ALPHA;(R)-2-(4-Methyl-3-cyclohexenyl)isopropanol, (R)-p-Menth-1-en-8-ol | | CAS: | 7785-53-7 | | MF: | C10H18O | | MW: | 154.25 | | EINECS: | 232-081-5 | | Product Categories: | | | Mol File: | 7785-53-7.mol |  |
| | (+)-ALPHA-TERPINEOL Chemical Properties |
| Boiling point | 72 °C(Press: 4 Torr) | | density | 0.94 g/mL at 20 °C(lit.) | | Fp | 90 °C | | storage temp. | 2-8°C | | pka | 15.09±0.29(Predicted) | | Appearance | Colorless to light yellow Liquid | | Odor | at 100.00 %. lilac floral | | Odor Type | floral | | Optical Rotation | [α]/D +90±10°, c = 0.1 in ethanol | | BRN | 2041428 | | Major Application | food and beverages | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C10H18O/c1-8-4-6-9(7-5-8)10(2,3)11/h4,9,11H,5-7H2,1-3H3/t9-/m0/s1 | | InChIKey | WUOACPNHFRMFPN-VIFPVBQESA-N | | SMILES | CC1=CC[C@@H](CC1)C(C)(C)O | | LogP | 2.708 (est) | | EPA Substance Registry System | 3-Cyclohexene-1-methanol, .alpha.,.alpha.,4-trimethyl-, (1R)- (7785-53-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 2 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (+)-ALPHA-TERPINEOL Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. | | Definition | ChEBI: The (4R)-stereoiosmer of alpha-terpineol. |
| | (+)-ALPHA-TERPINEOL Preparation Products And Raw materials |
|