| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
N6-2-(4-Aminophenyl)ethyl-adenosine manufacturers
- APNEA
-
- $43.00
-
2026-07-14
- CAS:89705-21-5
- Purity: 99.88%
- Supply Ability: 10g
- APNEA
-
- $43.00
-
2026-07-14
- CAS:89705-21-5
- Purity: 99.88%
- Supply Ability: 10g
|
| | N6-2-(4-Aminophenyl)ethyl-adenosine Basic information |
| Product Name: | N6-2-(4-Aminophenyl)ethyl-adenosine | | Synonyms: | N6-2-(4-AMINOPHENYL)ETHYLADENOSINE (APNE A) ADENOSINE, N6-2-(4-AM;Adenosine, N6-2-(4-aminophenyl)ethyl, APNEA, N-[2-(4-Aminophenyl)ethyl]-adenosine;N6-2-(4-Aminophenyl)ethyladenosine,APNEA, Adenosine, N6-2-(4-aminophenyl)ethyl, N-[2-(4-Aminophenyl)ethyl]-adenosine;Adenosine, N-[2-(4-aminophenyl)ethyl]-;(2R,3R,4S,5R)-2-(6-((4-Aminophenethyl)amino)-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol;N6-[2-(4-Aminophenyl) ethyl]adenosine, APNEA, potent, non-selective A3 adenosine receptor agonist.;APNEA, 10 mM in DMSO;N6-2-(4-Aminophenyl)ethyladenosine | | CAS: | 89705-21-5 | | MF: | C18H22N6O4 | | MW: | 386.41 | | EINECS: | | | Product Categories: | | | Mol File: | 89705-21-5.mol |  |
| | N6-2-(4-Aminophenyl)ethyl-adenosine Chemical Properties |
| Boiling point | 781.8±70.0 °C(Predicted) | | density | 1.65±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | methanol: 0.2 mg/mL, slightly soluble | | pka | 13.12±0.70(Predicted) | | form | Solid | | color | Off-white to light brown | | InChIKey | XTPOZVLRZZIEBW-SCFUHWHPSA-N | | SMILES | Nc1ccc(CCNc2ncnc3n(cnc23)[C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)cc1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N6-2-(4-Aminophenyl)ethyl-adenosine Usage And Synthesis |
| Uses | N6-2-(4-Aminophenyl)ethyladenosine is an adenosine receptor agonist. | | Biological Activity | Potent, non-selective A3 adenosine receptor agonist. | | in vivo | APNEA (N6-[2-(4-Aminophenyl)ethyl]adenosine; 2-4 mg/kg) has no significant effect on seizure parameters (seizure severity, seizure duration and afterdischarge duration) in amygdala-kindled rats. N6-[2-(4-Aminophenyl)ethyl]adenosine is combined with antiepileptic drugs administered at doses ineffective in fully kindled rats[1]. |
| | N6-2-(4-Aminophenyl)ethyl-adenosine Preparation Products And Raw materials |
|