| Company Name: |
Shanghai Guchen Biotechnology Co., LTD
|
| Tel: |
021-34675735 19147740836 |
| Email: |
1986399151@qq.com |
| Products Intro: |
Product Name:tert-Butyl bicyclo[2.2.2]phosphorothionate CAS:70636-86-1 Package:2mg
|
| Company Name: |
Henan Vcommend Consultrading Co., Ltd.
|
| Tel: |
13393721940 |
| Email: |
sales@vcommend.com |
| Products Intro: |
Product Name:Tert-Butyl bicyclo[2.2.2]phosphorothionate (TBPS) CAS:70636-86-1 Purity:98.0% Package:25kg/drum
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:tert-Butyl bicyclo[2.2.2]phosphorothionate CAS:70636-86-1
|
TERT-BUTYL-BICYCLO [2.2.2] manufacturers
|
| | TERT-BUTYL-BICYCLO [2.2.2] Basic information |
| Product Name: | TERT-BUTYL-BICYCLO [2.2.2] | | Synonyms: | TERT-BUTYL BICYCLO[2.2.2]PHOSPHOROTHIONATE,TBPS;6,7-trioxa-1-phosphabicyclo(2.2.2)octane,4-tert-butyl-1-sulfide;cyclico,o,o-esterwith2-(tert-butyl)-2-(hydroxymethyl)-phosphorothioicaci;tert-butylbicyclophosphorothionate;TERT-BUTYL-BICYCLO [2.2.2];TERT-BUTYL-BICYCLO(2.2.2)PHOSPHOROTHIONA TE (TBPS) GABA-A AN;t-butyl-bicyclo[2.2.2]phosphorothionate,0to5;4-tert-Butyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane1-sulfide | | CAS: | 70636-86-1 | | MF: | C8H15O3PS | | MW: | 222.24 | | EINECS: | | | Product Categories: | | | Mol File: | 70636-86-1.mol | ![TERT-BUTYL-BICYCLO [2.2.2] Structure](CAS/GIF/70636-86-1.gif) |
| | TERT-BUTYL-BICYCLO [2.2.2] Chemical Properties |
| Boiling point | 231.3±23.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble | | form | solid | | color | white | | Stability: | Toxic | | InChI | InChI=1S/C8H15O3PS/c1-7(2,3)8-4-9-12(13,10-5-8)11-6-8/h4-6H2,1-3H3 | | InChIKey | VTBHBNXGFPTBJL-UHFFFAOYSA-N | | SMILES | P12(=S)OCC(C(C)(C)C)(CO1)CO2 |
| WGK Germany | 3 | | RTECS | TG0782500 |
| | TERT-BUTYL-BICYCLO [2.2.2] Usage And Synthesis |
| Uses | tert-Butyl bicyclo[2.2.2]phosphorothionate is a GABAA??receptor antagonist or open channel blockers. | | Definition | ChEBI: Tert-Butylbicyclophosphorothionate is an organic thiophosphate. | | Clinical Use | tert-Butyl bicyclo 2.2.2 phosphorothionate (TBPS) is used as a bicyclic phosphonate convulsant, a substance that acts on the brainstem or spinal cord to produce tonic or clonic convulsions, usually by removing the normal inhibitory tone. |
| | TERT-BUTYL-BICYCLO [2.2.2] Preparation Products And Raw materials |
|