| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:Cholesterol β-D-glucoside CAS:7073-61-2 Purity:>=95%(TLC) Package:10mg Remarks:B27577
|
| Company Name: |
Shanghai Hongye Biotechnology Co. Ltd
|
| Tel: |
400-9205774 |
| Email: |
sales@glpbio.cn |
| Products Intro: |
Product Name:Cholesterol β-D-Glucoside CAS:7073-61-2 Purity:>98% Package:1mg;10mg;50mg;100mg;
|
CHOLESTERYL B-D-GLUCURONIDE manufacturers
|
| | CHOLESTERYL B-D-GLUCURONIDE Basic information |
| Product Name: | CHOLESTERYL B-D-GLUCURONIDE | | Synonyms: | CHOLESTERYL B-D-GLUCURONIDE;cholesteryl beta-D-glucuronide;Cholesterol β-D-glucoside;Cholesteryl β-D-glucopyranoside;Cholesterol b-D-glucoside;Cholesterol β-D-glucoside;β-D-glucosyl cholesterol | | CAS: | 7073-61-2 | | MF: | C33H54O7 | | MW: | 562.77766 | | EINECS: | | | Product Categories: | | | Mol File: | 7073-61-2.mol |  |
| | CHOLESTERYL B-D-GLUCURONIDE Chemical Properties |
| storage temp. | Store at -20°C | | solubility | Ethanol: 20 mg/ml | | form | A solid | | Optical Rotation | [α]/D -49.0±3.0°, c = 0.5 in pyridine | | InChIKey | FSMCJUNYLQOAIM-UQBZCTSOSA-N | | SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | CHOLESTERYL B-D-GLUCURONIDE Usage And Synthesis |
| Uses | Cholesterol β-D-glucoside (Cholesteryl glucoside) is a heat shock transcription factor 1 (HSF1) activator. Cholesterol β-D-glucoside induces HSP70 in fibroblast cells[1]. | | Definition | ChEBI: Cholesteryl beta-D-glucoside is a sterol 3-beta-D-glucoside and a monosaccharide derivative. It is functionally related to a cholesterol. | | Biological Activity | A lipid mediator in he at stress responses in animals, shows anti-ulcer effect. | | References | [1] Shohko Kunimoto, et al. Steryl glucoside is a lipid mediator in stress-responsive signal transduction. Cell Struct Funct. 2002 Jun;27(3):157-62. DOI:10.1247/csf.27.157 |
| | CHOLESTERYL B-D-GLUCURONIDE Preparation Products And Raw materials |
|