| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | NIDA-41020 Basic information |
| Product Name: | NIDA-41020 | | Synonyms: | N-(Piperidin-1-yl)-5-(4-methoxyphenyl)-1-(2,4-dichlorophenyl)-4-methyl-1H-pyrazole-3-carboxamide;1H-Pyrazole-3-carboxamide, 1-(2,4-dichlorophenyl)-5-(4-methoxyphenyl)-4-methyl-N-1-piperidinyl-;NIDA-41020 >=97% (HPLC), solid;Alitretinoin Impurity 2 | | CAS: | 502486-89-7 | | MF: | C23H24Cl2N4O2 | | MW: | 459.37 | | EINECS: | | | Product Categories: | | | Mol File: | 502486-89-7.mol |  |
| | NIDA-41020 Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: ~16mg/mL | | form | solid | | color | off-white | | InChI | 1S/C23H24Cl2N4O2/c1-15-21(23(30)27-28-12-4-3-5-13-28)26-29(20-11-8-17(24)14-19(20)25)22(15)16-6-9-18(31-2)10-7-16/h6-11,14H,3-5,12-13H2,1-2H3,(H,27,30) | | InChIKey | KWDBQJRWPWTGPF-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1)-c2c(C)c(nn2-c3ccc(Cl)cc3Cl)C(=O)NN4CCCCC4 |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | NIDA-41020 Usage And Synthesis |
| Uses | NIDA 41020 is an analog of rimonabant, which is a CB1 cannabinoic receptor antagonist that diminishes the behavioral effects of opiates and nicotine. | | Biochem/physiol Actions | NIDA-41020 is a CB1 cannabinoid receptor antagonist. NIDA-41020 is structurally similar to Rimonabant, which is currently in clinical development. NIDA-41020 is less lipophilic; developed at NIDA as a potential radioligand for CB1 receptors, Ki = 4.1 nM [in comparison AM 251, AM 281, SR 141716 (Rimonabant) have Ki of 0.6, 4.5 and 1.8 nM respectively]. | | IC 50 | CB1: 4.1 nM (Ki) |
| | NIDA-41020 Preparation Products And Raw materials |
|