|
|
| | THIENO(3 2-B)PYRIDIN-7-OL Basic information |
| | THIENO(3 2-B)PYRIDIN-7-OL Chemical Properties |
| Melting point | 230-235 °C(lit.) | | Boiling point | 321.4±22.0 °C(Predicted) | | density | 1.444±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 4.05±0.40(Predicted) | | color | White to Light yellow to Light orange | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C7H5NOS/c9-6-1-3-8-5-2-4-10-7(5)6/h1-4H,(H,8,9) | | InChIKey | AACVULYSNJAKEQ-UHFFFAOYSA-N | | SMILES | C12C=CSC1=C(O)C=CN=2 | | CAS DataBase Reference | 107818-20-2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | THIENO(3 2-B)PYRIDIN-7-OL Usage And Synthesis |
| Uses | Thieno[3,2-b]pyridin-7-ol may be used in the synthesis of 7-bromothieno[3,2-b]pyridine. | | General Description | Thieno[3,2-b]pyridin-7-ol is a thienopyridine derivative. |
| | THIENO(3 2-B)PYRIDIN-7-OL Preparation Products And Raw materials |
|