|
|
| | FLUORESCEIN O-METHACRYLATE 97 Basic information |
| Product Name: | FLUORESCEIN O-METHACRYLATE 97 | | Synonyms: | FLUORESCEIN O-METHACRYLATE 97;Methacryloyloxy fluorescein, 3μ-Methacryloxyspirobenzo[c]-furan[1,9]xanthen-3-one;Fluorescein O-Methacrylate 97%;2-Propenoic acid, 2-methyl-, 6'-hydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3'-yl ester;(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2-methylprop-2-enoate;3'-Hydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthen]-6'-yl methacrylate;Fluorescein O-methacrylate;3′-Methylacryloyloxy-spirobenzo[C]furan[1,9']thioketone | | CAS: | 480439-15-4 | | MF: | C24H16O6 | | MW: | 400.38 | | EINECS: | | | Product Categories: | | | Mol File: | 480439-15-4.mol |  |
| | FLUORESCEIN O-METHACRYLATE 97 Chemical Properties |
| Melting point | 227-232 °C(lit.) | | Boiling point | 636.6±55.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 9.35±0.20(Predicted) | | color | Light yellow to yellow | | λmax | 490 nm | | InChI | 1S/C24H16O6/c1-13(2)22(26)28-15-8-10-19-21(12-15)29-20-11-14(25)7-9-18(20)24(19)17-6-4-3-5-16(17)23(27)30-24/h3-12,25H,1H2,2H3 | | InChIKey | YMHPNLUYVDEYCI-UHFFFAOYSA-N | | SMILES | CC(=C)C(=O)Oc1ccc2c(Oc3cc(O)ccc3C24OC(=O)c5ccccc45)c1 | | CAS DataBase Reference | 480439-15-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-28 | | WGK Germany | 1 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | FLUORESCEIN O-METHACRYLATE 97 Usage And Synthesis |
| Uses | Fluorescein O-methacrylate can be used as a marker that can be incorporated into the nanoparticle complexes for biological applications. It forms environmentally responsive materials that can be used as probes for cellular imaging. | | General Description | Fluorescein O-methacrylate is a pH sensitive dye with a fluorescent monomer. It can be characterized by an excitation spectra at 490 nm and an emission spectra at 520 nm. It has fluorescein that acts as an indicator with the least negative charges. Its properties include biocompatibility, non-toxicity and good dispersion in aqueous solution. |
| | FLUORESCEIN O-METHACRYLATE 97 Preparation Products And Raw materials |
|