| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:3,5-Diethoxybenzoyl chloride
CAS:347913-16-0
Purity:97% Package:1G,5G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:3,5-Diethoxybenzoyl chloride
CAS:347913-16-0
Purity:98% Remarks:B35169
|
|
| | 3 5-DIETHOXYBENZOYL CHLORIDE 97 Basic information |
| | 3 5-DIETHOXYBENZOYL CHLORIDE 97 Chemical Properties |
| Melting point | 70-74 °C(lit.) | | Boiling point | 330.1±22.0 °C(Predicted) | | density | 1.161±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C11H13ClO3/c1-3-14-9-5-8(11(12)13)6-10(7-9)15-4-2/h5-7H,3-4H2,1-2H3 | | InChIKey | JHDNGEJBXLHONS-UHFFFAOYSA-N | | SMILES | CCOc1cc(OCC)cc(c1)C(Cl)=O |
| Hazard Codes | C | | Risk Statements | 34-43 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Resp. Sens. 1
Skin Corr. 1B |
| | 3 5-DIETHOXYBENZOYL CHLORIDE 97 Usage And Synthesis |
| | 3 5-DIETHOXYBENZOYL CHLORIDE 97 Preparation Products And Raw materials |
|