|
|
| | FISETIN HYDRATE Basic information |
| Product Name: | FISETIN HYDRATE | | Synonyms: | 5-Deoxyquercetin, 3,3',4',7'-Tetrahydroxyflavone;3,3μ,4μ,7-Tetrahydroxyflavone, 5-Deoxyquercetin, Natural Brown1;Fisetin >=98%;Fisetin hydrate(1:x);4H-1-Benzopyran-4-one,2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-,hydrate;Deoxyquercetin;2-(3,4-Dihydroxyphenyl)-3,7-dihydroxy-4H-chromen-4-one hydrate(1:x);Fistin hydrate | | CAS: | 345909-34-4 | | MF: | C15H10O6 | | MW: | 286.238 | | EINECS: | 208-434-4 | | Product Categories: | Acacia;Bioactive Small Molecules;Building Blocks;Carbonyl Compounds;Cell Biology;Chemical Synthesis;F;Ketones;Nutrition Research;Organic Building Blocks;Phytochemicals by Plant (Food/Spice/Herb);Benzopyrans;Cancer Research;Chemopreventive Agents;Heterocyclic Building Blocks;Phytoestrogens;C15 to C38 | | Mol File: | 345909-34-4.mol |  |
| | FISETIN HYDRATE Chemical Properties |
| Melting point | >330 °C (lit.) | | storage temp. | -20°C | | Colour Index | 75620 | | form | Solid | | color | Light yellow to yellow | | BRN | 292829 | | InChI | 1S/C15H10O6.H2O/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7;/h1-6,16-18,20H;1H2 | | InChIKey | GYHFUROKCOMWNQ-UHFFFAOYSA-N | | SMILES | O.Oc1ccc2C(=O)C(O)=C(Oc2c1)c3ccc(O)c(O)c3 |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | LK9250000 | | F | 10 | | Storage Class | 13 - Non Combustible Solids |
| | FISETIN HYDRATE Usage And Synthesis |
| Uses | Fisetin is a naturally occurring therapeutically active flavonol which has been used in the synthesis of pharmaceutically active anti-inflammatory, anticonvulsant and antiproliferative agents. | | General Description | Fisetin is a dietary flavonoid found in many fruits and vegetables. It is shown to exhibit anti-cancer, anti-inflammatory, antioxidant activities and also enhance the memory. |
| | FISETIN HYDRATE Preparation Products And Raw materials |
|