- Valsartan Impurity 67
-
- $0.00 / 10mg
-
2025-12-16
- CAS:2393969-04-3
- Min. Order: 10mg
- Purity: 99%+ HPLC
- Supply Ability: 1000
|
| | N-NITROSO-DI-ISO-PROPYLAMINE Basic information |
| | N-NITROSO-DI-ISO-PROPYLAMINE Chemical Properties |
| Melting point | >300°C | | Boiling point | 194.5℃ | | density | 0.9422 | | refractive index | 1.4431 (estimate) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | Benzene (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | -2.65±0.70(Predicted) | | color | Off-White to Pale Yellow | | Water Solubility | 13.02g/L(24 ºC) | | InChI | InChI=1S/C6H14N2O/c1-5(2)8(7-9)6(3)4/h5-6H,1-4H3 | | InChIKey | AUIKJTGFPFLMFP-UHFFFAOYSA-N | | SMILES | CC(N(C(C)C)N=O)C | | CAS DataBase Reference | 601-77-4 |
| Risk Statements | 22-45 | | Safety Statements | 53 | | RIDADR | 2811 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29211990 | | Toxicity | LD50 orl-rat: 850 mg/kg ZEKBAI 69,103,67 |
| | N-NITROSO-DI-ISO-PROPYLAMINE Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | A nitroso compound that shows carcinogenic effect | | Uses | N-Nitrosodiisopropylamine ia a nitrosoamine compound that shows carcinogenic effect. | | Safety Profile | Confirmed carcinogen
with experimental carcinogenic and
tumorigenic data. Moderately toxic by
ingestion. When heated to decomposition it
emits toxic fumes of NOx. See also NNITROSO
COMPOUNDS and AMINES. |
| | N-NITROSO-DI-ISO-PROPYLAMINE Preparation Products And Raw materials |
|