| Company Name: |
Shanghai Beiwanta Biotechnology Co., Ltd. Gold
|
| Tel: |
021-67187366 19901745723 |
| Email: |
info@bwtlab.com |
| Products Intro: |
Product Name:Fenthion-oxon- sulfone CAS:14086-35-2 Purity:99% Package:1mg;5mg;10mg;50mg
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Fenthoxon Sulfone CAS:14086-35-2 Package:500Mg,50Mg
|
| Company Name: |
Shanghai BeiZhuo Biotech Co., Ltd.
|
| Tel: |
021-61119791,13386096464 |
| Email: |
bzswkf@foxmail.com |
| Products Intro: |
Product Name:FENTHION-OXON-SULFONE CAS:14086-35-2 Purity:99%
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Fenthion-oxon-sulfone CAS:14086-35-2 Purity:99% Package:10mg;100mg;1g
|
|
| | FENTHION-OXON-SULFONE Basic information |
| | FENTHION-OXON-SULFONE Chemical Properties |
| Boiling point | 402.1±45.0 °C(Predicted) | | density | 1.308±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | BRN | 8688755 | | Major Application | agriculture environmental | | InChI | InChI=1S/C10H15O6PS/c1-8-7-9(16-17(11,14-2)15-3)5-6-10(8)18(4,12)13/h5-7H,1-4H3 | | InChIKey | VUTHWSUXEOILTN-UHFFFAOYSA-N | | SMILES | P(OC1=CC=C(S(C)(=O)=O)C(C)=C1)(OC)(OC)=O | | EPA Substance Registry System | Phosphoric acid, dimethyl 3-methyl-4-(methylsulfonyl)phenyl ester (14086-35-2) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | 2783 | | WGK Germany | 1 | | RTECS | TC5000000 | | HazardClass | 6.1(a) | | PackingGroup | II | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral |
| | FENTHION-OXON-SULFONE Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A metabolite of Fenthion (FEN) |
| | FENTHION-OXON-SULFONE Preparation Products And Raw materials |
|