|
|
| | 2-PHENYL-4-[3H]QUINAZOLINONE Basic information | | Application |
| Product Name: | 2-PHENYL-4-[3H]QUINAZOLINONE | | Synonyms: | 2-Phenylquinazoline-4(1H)-one;2-phenylquinazolin-4-ol;NSC 131274;NSC 400966;2-phenyl-1H-quinazolin-4-one;2-Phenyl-3H-quinazolin-4-one;2-Phenyl-4-quinazolinone;2-Phenyl-4-quinazolone | | CAS: | 1022-45-3 | | MF: | C14H10N2O | | MW: | 222.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1022-45-3.mol | ![2-PHENYL-4-[3H]QUINAZOLINONE Structure](CAS/GIF/1022-45-3.gif) |
| | 2-PHENYL-4-[3H]QUINAZOLINONE Chemical Properties |
| Melting point | 122 °C | | Boiling point | 398.2±25.0 °C(Predicted) | | density | 1.24 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Solid | | pka | 6.76±0.20(Predicted) | | color | Off-White to Pale Beige | | InChI | InChI=1S/C14H10N2O/c17-14-11-8-4-5-9-12(11)15-13(16-14)10-6-2-1-3-7-10/h1-9H,(H,15,16,17) | | InChIKey | VDULOAUXSMYUMG-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(=O)NC=1C1=CC=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-PHENYL-4-[3H]QUINAZOLINONE Usage And Synthesis |
| Application | 2-Phenylacetone has good biological activity and plays an important role in the development of pharmaceuticals and novel, highly efficient pesticides. | | Synthesis Reference(s) | Tetrahedron Letters, 14, p. 359, 1973 DOI: 10.1016/S0040-4039(01)95661-8 Chemical and Pharmaceutical Bulletin, 24, p. 1197, 1976 DOI: 10.1248/cpb.24.1197 Journal of the American Chemical Society, 86, p. 2086, 1964 DOI: 10.1021/ja01064a048 |
| | 2-PHENYL-4-[3H]QUINAZOLINONE Preparation Products And Raw materials |
|