Ethanone, 1-(2-chlorophenyl)-2-(2H-tetrazol-2-yl)- manufacturers
|
| | Ethanone, 1-(2-chlorophenyl)-2-(2H-tetrazol-2-yl)- Basic information |
| Product Name: | Ethanone, 1-(2-chlorophenyl)-2-(2H-tetrazol-2-yl)- | | Synonyms: | Ethanone, 1-(2-chlorophenyl)-2-(2H-tetrazol-2-yl)-;Benzonatate Impurity 3;1-(2-Chlorophenyl)-2-(2-tetrazolyl)ethanone;(2-chlorophenyl)-2-(1,2,3,4-tetrazol-2-yl)ethan-1-one;SUN59716;Cenobamate intermediate;1-(2-chlorophenyl)-2-(2H-tetrazol-2-yl)-;Cenobamate Impurity 3 | | CAS: | 1259059-71-6 | | MF: | C9H7ClN4O | | MW: | 222.63 | | EINECS: | | | Product Categories: | | | Mol File: | 1259059-71-6.mol |  |
| | Ethanone, 1-(2-chlorophenyl)-2-(2H-tetrazol-2-yl)- Chemical Properties |
| Boiling point | 380.7±48.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | pka | -0.31±0.42(Predicted) | | InChI | InChI=1S/C9H7ClN4O/c10-8-4-2-1-3-7(8)9(15)5-14-12-6-11-13-14/h1-4,6H,5H2 | | InChIKey | SLILCNKDGFOZOJ-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=CC=C1Cl)CN1N=NC=N1 |
| | Ethanone, 1-(2-chlorophenyl)-2-(2H-tetrazol-2-yl)- Usage And Synthesis |
| Uses | 1-(2-Chlorophenyl)-2-(2H-tetrazol-2-yl)ethanone is an intermediate in the synthesis of Cenobamate (C913080), which can be used to treat focal-onset seizures in adults. |
| | Ethanone, 1-(2-chlorophenyl)-2-(2H-tetrazol-2-yl)- Preparation Products And Raw materials |
|