7-chloronaphtho[1,2-b]benzofuran manufacturers
|
| | 7-chloronaphtho[1,2-b]benzofuran Basic information |
| | 7-chloronaphtho[1,2-b]benzofuran Chemical Properties |
| Boiling point | 424.4±18.0 °C(Predicted) | | density | 1.354±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C16H9ClO/c17-13-6-3-7-14-15(13)12-9-8-10-4-1-2-5-11(10)16(12)18-14/h1-9H | | InChIKey | VUAVEBLCLSSNFR-UHFFFAOYSA-N | | SMILES | O1C2=C3C(C=CC=C3)=CC=C2C2=C(Cl)C=CC=C12 |
| | 7-chloronaphtho[1,2-b]benzofuran Usage And Synthesis |
| Uses |
7-chloronaphtho[1,2-b]benzofuran, a white powder, is an OLED material.
| | Application |
7-chloronaphtho[1,2-b]benzofuran is used as an important OLED materials and electronic chemical materials.
|
| | 7-chloronaphtho[1,2-b]benzofuran Preparation Products And Raw materials |
|