| Company Name: |
Chongqing jooe co., ltd |
| Tel: |
+undefined86-15223382610 |
| Email: |
info@jooe.com |
| Products Intro: |
Product Name:4-((4S,7S,10S,13S)-10-benzyl-7-isobutyl-15-methyl-13-((R)-2-methyloxirane-2-carbonyl)-2,5,8,11-tetraoxo-4-phenethyl-3,6,9,12-tetraazahexadecyl)morpholine 4-oxide CAS:1672698-96-2 Purity:0.99 Package:1kg,5kg,25kg
|
|
|
|
|
| Company Name: |
Shenzhen Roark Pharma-Tec Co., Ltd. Gold
|
| Tel: |
13128912434 |
| Email: |
2880126944@qq.com |
| Products Intro: |
Product Name:Carfilzomib Impurity 1 CAS:1672698-96-2 Purity:98% HPLC Package:10MG;25MG;50MG;100MG Remarks:C7-4401
|
Carfilzomib Impurity 4 (N-Oxide Impurity) manufacturers
- Carfilzomib Impurity 58
-
- $0.00 / 10mg
-
2026-01-23
- CAS:1672698-96-2
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | Carfilzomib Impurity 4 (N-Oxide Impurity) Basic information |
| Product Name: | Carfilzomib Impurity 4 (N-Oxide Impurity) | | Synonyms: | Carfilzomib Impurity 4 (N-Oxide Impurity);(αS)-2-[[2-(4-Oxido-4-Morpholinyl)acetyl]amino]Benzenebutanoyl-L-leucyl-N-[(1S)-3-methyl-1-[[(2R)-2-methyl-2-oxiranyl]carbonyl]butyl]-L-Phenylalaninamide;Carfilzomib N-Oxide Impurity;L-Phenylalaninamide, (αS)-2-[[2-(4-oxido-4-morpholinyl)acetyl]amino]benzenebutanoyl-L-leucyl-N-[(1S)-3-methyl-1-[[(2R)-2-methyl-2-oxiranyl]carbonyl]butyl]-;Caffezomib Impurity 58;Carfilzomib Impurities 58 | | CAS: | 1672698-96-2 | | MF: | C40H57N5O8 | | MW: | 735.91 | | EINECS: | | | Product Categories: | | | Mol File: | 1672698-96-2.mol |  |
| | Carfilzomib Impurity 4 (N-Oxide Impurity) Chemical Properties |
| pka | 11+-.0.46(Predicted) | | InChIKey | CMLXYRHHVYWBGV-NZTKNTHTSA-N | | SMILES | C([C@@]1(OC1)C)(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC1C=CC=CC=1)NC(=O)CN1(CCOCC1)=O)CC1C=CC=CC=1 |
| | Carfilzomib Impurity 4 (N-Oxide Impurity) Usage And Synthesis |
| Uses | O846805 is a impurity of Carfilzomib (C183460), a newly approved proteasome-inhibiting anticancer drug. |
| | Carfilzomib Impurity 4 (N-Oxide Impurity) Preparation Products And Raw materials |
|