| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3-(Aminomethyl)-5-(trifluoromethyl)aniline Basic information |
| | 3-(Aminomethyl)-5-(trifluoromethyl)aniline Chemical Properties |
| Boiling point | 255.8±40.0 °C(Predicted) | | density | 1.309±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | 8.85±0.10(Predicted) | | InChI | 1S/C8H9F3N2/c9-8(10,11)6-1-5(4-12)2-7(13)3-6/h1-3H,4,12-13H2 | | InChIKey | LZQNQVAKBKTESA-UHFFFAOYSA-N | | SMILES | NC1=CC(CN)=CC(C(F)(F)F)=C1 |
| Storage Class | 11 - Combustible Solids |
| | 3-(Aminomethyl)-5-(trifluoromethyl)aniline Usage And Synthesis |
| | 3-(Aminomethyl)-5-(trifluoromethyl)aniline Preparation Products And Raw materials |
|