2'-AMINO-3'-HYDROXYACETOPHENONE manufacturers
|
| | 2'-AMINO-3'-HYDROXYACETOPHENONE Basic information |
| Product Name: | 2'-AMINO-3'-HYDROXYACETOPHENONE | | Synonyms: | 3-HYDROXY-2-AMINO ACETOPHENONE;2’-amino-3’-hydroxy-acetophenon;2''-AMINO-3''-HYDROXYACETOPHENONE 98+%;1-(2-amino-3-hydroxyphenyl)ethanone;1-(2-amino-3-hydroxy-phenyl)ethanone;1-(2-azanyl-3-hydroxy-phenyl)ethanone;1-(2-amino-3-hydroxyphenyl)ethan-1-one;2'-Amino-3'-hydroxyacetophenone > | | CAS: | 4502-10-7 | | MF: | C8H9NO2 | | MW: | 151.16 | | EINECS: | | | Product Categories: | | | Mol File: | 4502-10-7.mol |  |
| | 2'-AMINO-3'-HYDROXYACETOPHENONE Chemical Properties |
| Melting point | 182°C | | Boiling point | 273.17°C (rough estimate) | | density | 1.2023 (rough estimate) | | refractive index | 1.5810 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMF: 2 mg/ml; DMSO: 1 mg/ml; Ethanol: Slightly soluble; PBS (pH 7.2): 0.25 mg/ml | | form | powder to crystal | | pka | 8.94±0.10(Predicted) | | color | Light yellow to Amber to Dark green | | InChI | InChI=1S/C8H9NO2/c1-5(10)6-3-2-4-7(11)8(6)9/h2-4,11H,9H2,1H3 | | InChIKey | DIIASMSSGMRMQF-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=CC(O)=C1N)C | | CAS DataBase Reference | 4502-10-7(CAS DataBase Reference) |
| | 2'-AMINO-3'-HYDROXYACETOPHENONE Usage And Synthesis |
| Uses | 1-(2-Amino-3-hydroxyphenyl)ethanone is the kynuridine metabolite, which could be extracted from rat liver mitochondrium. 1-(2-Amino-3-hydroxyphenyl)ethanone is associated with tryptophan metabolism disturbances, and can be used in bladder cancer, leukemia and anemia researches[1]. | | Preparation | Also obtained by bioconversion of nitro precursor using recombinant Escherichia coli strains. | | References | [1] Kaseda H, et al., Biosynthetic routes to 2-aminoacetophenone and 2-amino-3-hydroxyacetophenone. J Biochem. 1973 Jul;74(1):127-33. DOI:10.1093/oxfordjournals.jbchem.a130215 |
| | 2'-AMINO-3'-HYDROXYACETOPHENONE Preparation Products And Raw materials |
|