FMOC-L-TYR(ALL)-OH manufacturers
- Fmoc-tyr(all)-oh
-
- $0.00 / 1KG
-
2022-01-27
- CAS:146982-30-1
- Min. Order: 1KG
- Purity: 98.9%
- Supply Ability: 100 tons
- FMOC-L-TYR(ALL)-OH
-
- $1.00 / 1KG
-
2019-12-23
- CAS:146982-30-1
- Min. Order: 1KG
- Purity: 97%-99.9%
- Supply Ability: 100kg
|
| | FMOC-L-TYR(ALL)-OH Basic information |
| Product Name: | FMOC-L-TYR(ALL)-OH | | Synonyms: | N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-O-ALLYL-L-TYROSINE;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-O-ALLYL-L-TYROSINE;L-Tyrosine,N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-2-propen-1-yl-;(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-[4-(prop-2-en-1-yloxy)phenyl]propanoic acid;(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-prop-2-enoxyphenyl)propanoic acid;FMOC-TYR(ALL)-OH;FMOC-TYR(AL)-OH;FMOC-O-ALLYL-L-TYROSINE | | CAS: | 146982-30-1 | | MF: | C27H25NO5 | | MW: | 443.49 | | EINECS: | | | Product Categories: | | | Mol File: | 146982-30-1.mol |  |
| | FMOC-L-TYR(ALL)-OH Chemical Properties |
| Melting point | 140-142 °C | | Boiling point | 668.7±55.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 2.96±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | BRN | 9017221 | | Major Application | peptide synthesis | | InChIKey | AQUXDQFCBLRIRE-VWLOTQADSA-N | | SMILES | OC(=O)[C@H](Cc1ccc(OCC=C)cc1)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | FMOC-L-TYR(ALL)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-L-TYR(ALL)-OH Preparation Products And Raw materials |
|