|
|
| | 2-Amino-5-methylbenzoic acid Basic information |
| | 2-Amino-5-methylbenzoic acid Chemical Properties |
| Melting point | 175 °C (dec.) (lit.) | | Boiling point | 273.17°C (rough estimate) | | density | 1.2023 (rough estimate) | | refractive index | 1.5810 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Powder | | pka | 2.27±0.10(Predicted) | | color | Off-white to beige | | BRN | 1101527 | | Major Application | peptide synthesis | | InChI | InChI=1S/C8H9NO2/c1-5-2-3-7(9)6(4-5)8(10)11/h2-4H,9H2,1H3,(H,10,11) | | InChIKey | NBUUUJWWOARGNW-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(C)=CC=C1N | | CAS DataBase Reference | 2941-78-8(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Amino-5-methylbenzoic acid(2941-78-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Amino-5-methylbenzoic acid Usage And Synthesis |
| Chemical Properties | Light-Brown Solid | | Uses | 2-Amino-5-methylbenzoic acid can be used to synthesize quinazolinedione. | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | General procedure for the synthesis of 2-amino-5-methylbenzoic acid from 5-methyl-2-nitrobenzoic acid: 5-methyl-2-nitrobenzoic acid (20 g, 110 mmol) was dissolved in ethanol and 10% palladium/carbon catalyst (1 g) was added. The reaction mixture was stirred overnight at room temperature and under hydrogen atmosphere. Upon completion of the reaction, the catalyst was removed by filtration through diatomaceous earth and the filtrate was concentrated under reduced pressure to give 16 g (96% yield) of the white solid product 2-amino-5-methylbenzoic acid. Melting point: 162 °C. 1H NMR (DMSO-d6) δ: 2.13 (s, 3H), 6.65 (d, J=8.6 Hz, 1H), 7.06 (dd, J=8.6,1.8 Hz, 1H), 7.48 (d, J=1.1 Hz, 1H).EIMS m/z: 174 (M+1), 152 (M+23). | | References | [1] Patent: WO2004/74218, 2004, A2. Location in patent: Page 97
[2] Patent: US2008/139551, 2008, A1. Location in patent: Page/Page column 41
[3] Journal of Organic Chemistry, 2016, vol. 81, # 19, p. 9046 - 9074
[4] Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982, # 8, p. 1637 - 1648
[5] Chemische Berichte, 1905, vol. 38, p. 3555 |
| | 2-Amino-5-methylbenzoic acid Preparation Products And Raw materials |
|