| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Rink amide resin Basic information |
| | Rink amide resin Chemical Properties |
| storage temp. | 2-8°C | | form | Beads | | color | Off-white to pinkish-brown | | Major Application | peptide synthesis | | SMILES | [X]Oc1ccc(cc1)CN(c5c(cc(cc5)OC)OC)C(=O)OCC2c3c(cccc3)c4c2cccc4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Rink amide resin Usage And Synthesis |
| Chemical Properties | Pale white or slight yellow beads | | Uses | RINK AMIDE-AM RESIN is an excellent tool for SPPS of peptide amines utilizing Fmoc-protected amino acids. This resin is commonly utilized in combinatorial chemistry to prepare amides, it can be easily cleaved by TFA. This product can be used if a C-terminal amide is desired. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Rink amide resin Preparation Products And Raw materials |
|