|
|
| | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)CHLOROBENZENE Basic information |
| Product Name: | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)CHLOROBENZENE | | Synonyms: | 2-(4-Chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4-Chlorobenzeneboronic acid, pinacol ester;4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)CHLOROBENZENE;4-CHLOROPHENYLBORONIC ACID, PINACOL ESTER;4-Chlorophenylboronic acid pinacol ester 97%;Pinacol (4-chlorophenyl)boronate;Pinac;1,3,2-Dioxaborolane, 2-(4-chlorophenyl)-4,4,5,5-tetramethyl- | | CAS: | 195062-61-4 | | MF: | C12H16BClO2 | | MW: | 238.52 | | EINECS: | | | Product Categories: | Chemical Synthesis;Organometallic Reagents;Aryl Boronate Esters;Boronate Esters;Boronic Acids and Derivatives | | Mol File: | 195062-61-4.mol |  |
| | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)CHLOROBENZENE Chemical Properties |
| Melting point | 50-55 °C(lit.) | | Boiling point | 308.7±25.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | Solid | | color | White to pale brown | | InChI | InChI=1S/C12H16BClO2/c1-11(2)12(3,4)16-13(15-11)9-5-7-10(14)8-6-9/h5-8H,1-4H3 | | InChIKey | NYARTXMDWRAVIX-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C1=CC=C(Cl)C=C1 | | CAS DataBase Reference | 195062-61-4 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 |
| | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)CHLOROBENZENE Usage And Synthesis |
| Uses | 4-Chlorophenylboronic acid pinacol ester can be used as a reagent in Suzuki-Miyaura cross-coupling reaction to form C-C bonds by reacting with different aryl halides over palladium catalysts. It can also be used as a reactant:
- To prepare 2-(4-chlorophenyl)-4H-chromen-4-one by treating with 4-chromanone via one-pot palladium-catalyzed dehydrogenation and oxidative boron-Heck coupling reaction.
- In the ligand-enabled C-H bond activation reaction in the presence of a palladium catalyst.
- To synthesize biaryl amides via Cu-catalyzed C-H bond coupling of aryl arylamides.
|
| | 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)CHLOROBENZENE Preparation Products And Raw materials |
| Raw materials | 4-CHLOROPHENYLBORONIC ACID, CATECHOL CYCLIC ESTER-->Diazene, 1-(4-chlorophenyl)-2-(methylsulfonyl)--->3-CHLOROPHENYLBORONIC ACID, PINACOL ESTER-->Bis[(pinacolato)boryl]Methane-->boranylbis(propan-2-yl)amine-->Benzenediazonium, p-chloro-, tetrafluoroborate(1-)-->4-Chlorophenylboronic acid-->Pinacol-->1-Chloro-4-iodobenzene | | Preparation Products | 4-Chloro-alpha-methylstyrene-->1-((4'-chloro-5,5-dimethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-yl)methyl)piperazine-->4-Carboxylphenylboronic acid pinacol ester |
|