|
|
| | 2-Amino-4-(4-ethoxy-phenyl)thiophene-3-carboxylic ethyl ester Basic information |
| Product Name: | 2-Amino-4-(4-ethoxy-phenyl)thiophene-3-carboxylic ethyl ester | | Synonyms: | ETHYL 2-AMINO-4-(4-ETHOXYPHENYL)THIOPHENE-3-CARBOXYLATE;AURORA 20514;2-amino-4-(4-ethoxyphenyl)-3-thiophenecarboxylic acid ethyl ester;2-Amino-4-(4-ethoxy-phenyl)-thiophene-3-carboxylic acid ethyl ester;2-amino-4-(4-ethoxyphenyl)thiophene-3-carboxylic acid ethyl ester;BAS 03011962;BIM-0030697.P001;CBMicro_030664 | | CAS: | 315684-37-8 | | MF: | C15H17NO3S | | MW: | 291.37 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Amino-4-(4-ethoxy-phenyl)thiophene-3-carboxylic ethyl ester Chemical Properties |
| Boiling point | 435.5±45.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | pka | -0.01±0.14(Predicted) | | form | solid | | InChI | 1S/C15H17NO3S/c1-3-18-11-7-5-10(6-8-11)12-9-20-14(16)13(12)15(17)19-4-2/h5-9H,3-4,16H2,1-2H3 | | InChIKey | AIKLQCJSBQOIDZ-UHFFFAOYSA-N | | SMILES | O=C(OCC)C1=C(N)SC=C1C2=CC=C(OCC)C=C2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-Amino-4-(4-ethoxy-phenyl)thiophene-3-carboxylic ethyl ester Usage And Synthesis |
| | 2-Amino-4-(4-ethoxy-phenyl)thiophene-3-carboxylic ethyl ester Preparation Products And Raw materials |
|