|
|
| | RAC-2-(DI-T-BUTYLPHOSPHINO)-1,1'-BINAPHTHYL Basic information | | Reaction |
| Product Name: | RAC-2-(DI-T-BUTYLPHOSPHINO)-1,1'-BINAPHTHYL | | Synonyms: | 2-(DI-TERT-BUTYLPHOSPHINO)-1,1'-BINAPHTHYL;RAC-2-(DI-T-BUTYLPHOSPHINO)-1,1'-BINAPHTHYL;RACEMIC-2-(DI-T-BUTYLPHOSPHINO)-1,1'-BINAPHTHYL;rac-2-(Di-t-butylphosphino)-1,1'-binaphthyl,98%;racemic-2-Di-t-butylphosphino-1,1'-binaphthyl,98%;PHOSPHINE, [1,1''-BINAPHTHALEN]-2-YLBIS(1,1-DIMETHYLETHYL)-;2-(Di-tert-butylphosphino)-1,1'-binaphthyl,98%;RaceMic-2-di-tert-butylphosphino-1,1-binaphthyl | | CAS: | 255836-67-0 | | MF: | C28H31P | | MW: | 398.52 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Buchwald Ligands Series;Buchwald Ligands&Precatalysts | | Mol File: | 255836-67-0.mol |  |
| | RAC-2-(DI-T-BUTYLPHOSPHINO)-1,1'-BINAPHTHYL Chemical Properties |
| Melting point | 144-148 °C | | Boiling point | 519.5±29.0 °C(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | crystal | | color | white | | InChI | InChI=1S/C28H31P/c1-27(2,3)29(28(4,5)6)25-19-18-21-13-8-10-16-23(21)26(25)24-17-11-14-20-12-7-9-15-22(20)24/h7-19H,1-6H3 | | InChIKey | QGBQGMHXBSLYLZ-UHFFFAOYSA-N | | SMILES | P(C1=CC=C2C(=C1C1=C3C(C=CC=C3)=CC=C1)C=CC=C2)(C(C)(C)C)C(C)(C)C | | CAS DataBase Reference | 255836-67-0 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29029090 |
| Provider | Language |
|
ACROS
| English |
| | RAC-2-(DI-T-BUTYLPHOSPHINO)-1,1'-BINAPHTHYL Usage And Synthesis |
| Reaction |
- Ligand for the Pd-catalyzed formation of oxygen heterocycles.
- Ligand for the intermolecular Pd-catalyzed synthesis of aryl ethers.
- Ligand for the intramolecular Pd-catalyzed synthesis of aryl ethers.
- Ligand for the synthesis of carbazoles by Pd-catalyzed double N-arylation reaction.
- Ligand for the Pd-catalyzed cyanation of (hetero)arylchlorides.
- Ligand for the Pd-catalyzed intramolecular synthesis of carbazoles via C-H functionalization.
| | Chemical Properties | White to pale yellow crystalline powder | | Uses | 2-(Di-tert-butylphosphino)-1,1''-binaphthyl 98% TrixiePhos is a reagent used as ligand in palladium-catalyzed C-O, C-N, and C-C bond forming reactions. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand
reaction type: Cross Couplings |
| | RAC-2-(DI-T-BUTYLPHOSPHINO)-1,1'-BINAPHTHYL Preparation Products And Raw materials |
|