2',5'-DIDEOXYADENOSINE manufacturers
|
| | 2',5'-DIDEOXYADENOSINE Basic information |
| Product Name: | 2',5'-DIDEOXYADENOSINE | | Synonyms: | 2',5'-DD-ADO;5-(6-AMINOPURIN-9-YL)-2-METHYLTETRAHYDROFURAN-3-OL;(2R,3S,5R)-5-(6-aMino-9H-purin-9-yl)-2-Methyltetrahydrofuran-3-ol;NSC 95943;NSC 95943 2',5'-DIDEOXYADENOSINE;phosphoric acid [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-2-oxolanyl]methyl [hydroxy(phosphonooxy)phosphoryl] [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] ester;2,5-Dideoxyadenosine - CAS 6698-26-6 - Calbiochem;Adenosine, 2',5'-dideoxy- | | CAS: | 6698-26-6 | | MF: | C10H13N5O2 | | MW: | 235.24 | | EINECS: | | | Product Categories: | Adenylate cyclaseG Proteins and Cyclic Nucleotides;Adenylyl Cyclase Inhibitors;A to;Cyclic Nucleotide Metabolism;Enzyme Inhibitors by Enzyme | | Mol File: | 6698-26-6.mol |  |
| | 2',5'-DIDEOXYADENOSINE Chemical Properties |
| Boiling point | 547.0±60.0 °C(Predicted) | | density | 1.77±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: soluble | | form | solid | | pka | 14.06±0.60(Predicted) | | color | white | | InChI | InChI=1S/C10H13N5O2/c1-5-6(16)2-7(17-5)15-4-14-8-9(11)12-3-13-10(8)15/h3-7,16H,2H2,1H3,(H2,11,12,13)/t5-,6+,7-/m1/s1 | | InChIKey | FFHPXOJTVQDVMO-DSYKOEDSSA-N | | SMILES | C[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)C[C@@H]1O |
| WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 2',5'-DIDEOXYADENOSINE Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 2′,5′-Dideoxyadenosine has been used to elucidate the mechanism of diligustilide (DLG). It has also been used to inhibit adenylate cyclase (AC). | | Biochem/physiol Actions | Cell-permeable adenylyl cyclase inhibitor. IC50 = 2.7 μM in detergent-dispersed rat brain preparations. | | in vivo | 2',5'-Dideoxyadenosine (0.1 mg/kg; IP; 15 min pre-treated) fully inhibits the diuretic, natriuretic and K+ and Cl- sparing effect of Fr EtOAc in rats[4].
| Animal Model: | Male Wistar rats (3-4 months old)[3] | | Dosage: | 0.1 mg/kg | | Administration: | IP; 15 min pre-treated | | Result: | Fully inhibited the diuretic, natriuretic and K+ and Cl- sparing effect of FrEtOAc in rats.
|
|
| | 2',5'-DIDEOXYADENOSINE Preparation Products And Raw materials |
|