3,5-DIBROMO-2-METHYLTHIOPHENE manufacturers
|
| 3,5-DIBROMO-2-METHYLTHIOPHENE Basic information |
| 3,5-DIBROMO-2-METHYLTHIOPHENE Chemical Properties |
Melting point | -15°C(lit.) | Boiling point | 230°C(lit.) | density | 2 | refractive index | 1.6120-1.6160 | storage temp. | 0-10°C | form | clear liquid | color | Colorless to Yellow | InChI | InChI=1S/C5H4Br2S/c1-3-4(6)2-5(7)8-3/h2H,1H3 | InChIKey | OGAJGUIMFMRGRB-UHFFFAOYSA-N | SMILES | C1(C)SC(Br)=CC=1Br | CAS DataBase Reference | 29421-73-6 |
Hazard Codes | Xi | HS Code | 2934999090 |
| 3,5-DIBROMO-2-METHYLTHIOPHENE Usage And Synthesis |
Uses | 3,5-Dibromo-2-methylthiophene is a useful reagent for the preparation of arylthiophene-substituted norbornadienes. |
| 3,5-DIBROMO-2-METHYLTHIOPHENE Preparation Products And Raw materials |
|