|
|
| | (3R,4S)-tert-Butyl 2-oxo-4-phenyl-3-(triethylsilyloxy)azetidine-1-carboxylate Basic information | | Application |
| Product Name: | (3R,4S)-tert-Butyl 2-oxo-4-phenyl-3-(triethylsilyloxy)azetidine-1-carboxylate | | Synonyms: | 2-oxo-4-phenyl-3-triethylsilyloxy-1-azetidinecarboxylic acid tert-butyl ester;DOCETAXEL SIDE CHAIN NO 2;(3R,4S)-TERT-BUTYL 2-OXO-4-PHENYL-3-(TRIETHYLSILYLOXY)AZETIDINE-1-CARBOXYLATE;(3R,4S)-2-Oxo-4-phenyl-3-[(triethylsilyl)oxy]-1-azetidinecarboxylic acid 1,1-dimethylethyl ester;(3R,4S)-1-t-Boc-3-[(triethylsilyl)oxy]-4-phenyl-2-azatidinone;(3R-cis)-2-Oxo-4-phenyl-3-[(triethylsilyl)oxy]-1-azetidinecarboxylic Acid 1,1-Dimethylethyl Ester;(3r,4s)-1-Azetidine Carboxylic Acid-2-Oxo-4-Phenyl-3-[(Triethylsilyl)Oxy]-1,1-Dimethyl Ethyl Ester;(3R,4S)-1-AZETIDINECARBOXYLIC ACID 2-OXO-4-PHENYL-3-[(TRIETHYLSILY)OXY]-1,1-DIMETHYLETHYL ESTER | | CAS: | 149198-47-0 | | MF: | C20H31NO4Si | | MW: | 377.55 | | EINECS: | | | Product Categories: | CHIRAL CHEMICALS;Intermediates;Ketone;Chiral Reagents;Heterocycles | | Mol File: | 149198-47-0.mol |  |
| | (3R,4S)-tert-Butyl 2-oxo-4-phenyl-3-(triethylsilyloxy)azetidine-1-carboxylate Chemical Properties |
| Boiling point | 463.1±45.0 °C(Predicted) | | density | 1.07 | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Oil | | pka | -4.79±0.60(Predicted) | | color | Colourless | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C20H31NO4Si/c1-7-26(8-2,9-3)25-17-16(15-13-11-10-12-14-15)21(18(17)22)19(23)24-20(4,5)6/h10-14,16-17H,7-9H2,1-6H3/t16-,17+/m0/s1 | | InChIKey | LHTDXUKSFSMGCA-DLBZAZTESA-N | | SMILES | N1(C(OC(C)(C)C)=O)[C@@H](C2=CC=CC=C2)[C@@H](O[Si](CC)(CC)CC)C1=O | | CAS DataBase Reference | 149198-47-0(CAS DataBase Reference) |
| | (3R,4S)-tert-Butyl 2-oxo-4-phenyl-3-(triethylsilyloxy)azetidine-1-carboxylate Usage And Synthesis |
| Application | (3R,4S)-3-(triethylsiloxy)-4-phenyl-2-oxo-azacyclobut-1-carboxylic acid tert-butyl ester is an organic synthesis intermediate and a pharmaceutical intermediate that can be used in laboratory research and development processes as well as in chemical and pharmaceutical synthesis processes. | | Chemical Properties | Syrup |
| | (3R,4S)-tert-Butyl 2-oxo-4-phenyl-3-(triethylsilyloxy)azetidine-1-carboxylate Preparation Products And Raw materials |
|