| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (E)-4-(5-Chloro-2-hydroxyphenyl)-1H-benzo[b][1,4]diazepin-2(3H)-one Basic information |
| | (E)-4-(5-Chloro-2-hydroxyphenyl)-1H-benzo[b][1,4]diazepin-2(3H)-one Chemical Properties |
| form | solid | | InChI | 1S/C15H11ClN2O2/c16-9-5-6-14(19)10(7-9)13-8-15(20)18-12-4-2-1-3-11(12)17-13/h1-8,17,19H,(H,18,20) | | InChIKey | CUAUGGNUSVMBKP-UHFFFAOYSA-N | | SMILES | O=C(C1)NC2=C(C=CC=C2)N=C1C3=CC(Cl)=CC=C3O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Sens. 1 |
| | (E)-4-(5-Chloro-2-hydroxyphenyl)-1H-benzo[b][1,4]diazepin-2(3H)-one Usage And Synthesis |
| | (E)-4-(5-Chloro-2-hydroxyphenyl)-1H-benzo[b][1,4]diazepin-2(3H)-one Preparation Products And Raw materials |
|