|
|
| | 4-Methyl-1-piperazinecarbonyl chloride hydrochloride Basic information |
| | 4-Methyl-1-piperazinecarbonyl chloride hydrochloride Chemical Properties |
| Melting point | 225-228 °C(lit.) | | Boiling point | 94-96 °C(Press: 10 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C6H11ClN2O.ClH/c1-8-2-4-9(5-3-8)6(7)10;/h2-5H2,1H3;1H | | InChIKey | WICNYNXYKZNNSN-UHFFFAOYSA-N | | SMILES | N1(CCN(C)CC1)C(Cl)=O.Cl | | CAS DataBase Reference | 55112-42-0(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | HS Code | 2933599590 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-Methyl-1-piperazinecarbonyl chloride hydrochloride Usage And Synthesis |
| Uses | 4-Methyl-1-piperazinecarbonyl chloride hydrochloride may be used in the synthesis of tert-butyl 2-(N-ethyl-4-methylpiperzaine-1-carboxamido)ethylcarbamate and 4b,8,8-trimethyl-9,10-dioxo-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl 4-methyl-piperazine-1-carboxylate. |
| | 4-Methyl-1-piperazinecarbonyl chloride hydrochloride Preparation Products And Raw materials |
|