|
|
| | Procarbazone sodium Basic information |
| Product Name: | Procarbazone sodium | | Synonyms: | methyl 2-((((4,5-dihydro-4-methyl-5-oxo-3-propoxy-1h-1,2,4-triazol-1-yl)carbonyl)amino)sulfonyl)benzoate sodium salt;ATTRIBUT;2-[(4-METHYL-5-OXO-3-PROPOXY-1,2,4-TRIAZOLIN-1-YL)CARBAMIDOSULFONYL]BENZOIC ACID METHYL ESTER SODIUM SALT;OLYMPUS;PROPOXYCARBAZONE SODIUM;PROPOXYCARBAZONE SODIUM SALT;Procarbazone sodium;MKH 6561 | | CAS: | 181274-15-7 | | MF: | C15H17N4NaO7S | | MW: | 420.37 | | EINECS: | | | Product Categories: | | | Mol File: | 181274-15-7.mol |  |
| | Procarbazone sodium Chemical Properties |
| Melting point | 230-240° (dec) | | storage temp. | 0-6°C | | solubility | Solubilities in organic solvents (g/l at 20 °C) Dimethylsulfoxide: 190 Poly(ethylene glycol): 5.2 Acetonitrile: 0.9 2‐Propanol: <0.1 Xylene: <0.1 | | pka | The free acid produced by protonation under acidic conditions has a pKa of 2.1 (at 20 °C) | | Water Solubility | Solubility in water (at 20 °C) : Unbuffered water and buffered between pH 7 and 9: 42 g/l. Solubility is not influenced by pH in the range pH 7-9. Solubility at pH 4.5: 2.9 g/l | | Stability: | Hygroscopic | | InChI | InChI=1S/C15H18N4O7S.Na/c1-4-9-26-14-16-19(15(22)18(14)2)13(21)17-27(23,24)11-8-6-5-7-10(11)12(20)25-3;/h5-8H,4,9H2,1-3H3,(H,17,21);/q;+1/p-1 | | InChIKey | JRQGDDUXDKCWRF-UHFFFAOYSA-M | | SMILES | N1(N=C(OCCC)N(C)C1=O)C(=O)N([Na])S(=O)(=O)C1=CC=CC=C1C(OC)=O | | CAS DataBase Reference | 181274-15-7 | | EPA Substance Registry System | Propoxycarbazone-sodium (181274-15-7) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 2 | | Hazardous Substances Data | 181274-15-7(Hazardous Substances Data) | | Toxicity | LD50 in rats (mg/kg): >5000 orally; >5000 dermally; LC50 in rats (mg/m3): >5030 in air by inhalation; LC50 (96 hr) in bluegill sunfish, rainbow trout (mg/l): >94.7; >77.6 (Feucht) |
| | Procarbazone sodium Usage And Synthesis |
| Chemical Properties | Pure product is colorless and odorless powder crystals. m.p. 230~240℃, decomposition during melting, relative density 1.42 (20℃), vapor pressure <1×10-8Pa (20℃), partition coefficient -0.30 (pH=4.0), -1.55 (pH=7.0), -1.59 (pH=9.0). solubility at 20℃ is: dichloromethane 1.50g/L, n-heptane<0.1 g/L, xylene<0.1 g/L, isopropanol<0.1 g/L, water 42g/L (pH=7-9), 2.9g/L (pH=4.5). Stable in air at room temperature, easily degraded in soil, half-life is 9d. | | Uses | Herbicide. |
| | Procarbazone sodium Preparation Products And Raw materials |
|