|
|
| | 2-Oxo-4-phenylbutyric acid Basic information | | Uses |
| Product Name: | 2-Oxo-4-phenylbutyric acid | | Synonyms: | BENZYLPYRUVIC ACID;CHEMBRDG-BB 4013598;2-OXO-4-PHENYL-BUTYRIC ACID;2-OXO-4-PHENYL BUTANOIC ACID;A-CARBONYLPHENYLBUTYRIC ACID;ALPHA-CARBONYL PHENYL BUTYRIC ACID;α-CARBONYLPHENYLBUTYRIC ACID;2-OXO-4-PHENYL BUTANOIC ACID OPBA | | CAS: | 710-11-2 | | MF: | C10H10O3 | | MW: | 178.18 | | EINECS: | 211-916-7 | | Product Categories: | | | Mol File: | 710-11-2.mol |  |
| | 2-Oxo-4-phenylbutyric acid Chemical Properties |
| Melting point | 47.0 to 51.0 °C | | Boiling point | 314.4±21.0 °C(Predicted) | | density | 1.212±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | form | powder to crystal | | pka | 2.53±0.54(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C10H10O3/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13) | | InChIKey | PPKAIMDMNWBOKN-UHFFFAOYSA-N | | SMILES | C1(=CC=CC=C1)CCC(=O)C(=O)O | | CAS DataBase Reference | 710-11-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | HazardClass | IRRITANT | | HS Code | 2915601990 |
| | 2-Oxo-4-phenylbutyric acid Usage And Synthesis |
| Uses | 2-Oxo-4-phenylbutyric acid is an acid derivative that can be used as a pharmaceutical synthesis intermediate. | | Chemical Properties | White flakepowder | | Definition | ChEBI: 2-Oxo-4-phenylbutyric acid is a member of benzenes. |
| | 2-Oxo-4-phenylbutyric acid Preparation Products And Raw materials |
|