- N-(4-Chlorobenzoyl)-tyramine
-
- $15.00 / 1KG
-
2021-08-12
- CAS:41859-57-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- N-(4-Chlorobenzoyl)-tyramine
-
- $15.00 / 1KG
-
2021-07-13
- CAS:41859-57-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | N-(4-Chlorobenzoyl)-tyramine Basic information |
| | N-(4-Chlorobenzoyl)-tyramine Chemical Properties |
| Melting point | 170-1720C | | Boiling point | 505.4±40.0 °C(Predicted) | | density | 1.268±0.06 g/cm3(Predicted) | | RTECS | CV2450481 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.01±0.15(Predicted) | | color | Pale Red to Light Brown | | InChI | 1S/C15H14ClNO2/c16-13-5-3-12(4-6-13)15(19)17-10-9-11-1-7-14(18)8-2-11/h1-8,18H,9-10H2,(H,17,19) | | InChIKey | ZTLWJYCDAXUIBK-UHFFFAOYSA-N | | SMILES | ClC1=CC=C(C(NCCC2=CC=C(O)C=C2)=O)C=C1 | | CAS DataBase Reference | 41859-57-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 2924.29.7790 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| | N-(4-Chlorobenzoyl)-tyramine Usage And Synthesis |
| Chemical Properties | Pale-Yellow Solid | | Uses | Intermediate in the preparation of Bezafibrate |
| | N-(4-Chlorobenzoyl)-tyramine Preparation Products And Raw materials |
|