|
|
| | 1-Ethyl-3-methylimidazolium trifluoromethanesulfonate Basic information |
| | 1-Ethyl-3-methylimidazolium trifluoromethanesulfonate Chemical Properties |
| Melting point | -12°C | | Boiling point | >350 °C (lit.) | | density | 1.387 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.435(lit.) | | Fp | >230 °F | | storage temp. | Store below +30°C. | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C6H11N2.CHF3O3S/c1-3-8-5-4-7(2)6-8;2-1(3,4)8(5,6)7/h4-6H,3H2,1-2H3;(H,5,6,7)/q+1;/p-1 | | InChIKey | ZPTRYWVRCNOTAS-UHFFFAOYSA-M | | SMILES | N1(CC)C=C[N+](C)=C1.C(F)(F)(F)S([O-])(=O)=O | | LogP | -2.5--2.2 at 23℃ and pH6.8 | | CAS DataBase Reference | 145022-44-2(CAS DataBase Reference) | | ECW | 3.9 V |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | F | 9-21 | | HazardClass | IRRITANT | | HS Code | 29332900 | | Storage Class | 10 - Combustible liquids |
| | 1-Ethyl-3-methylimidazolium trifluoromethanesulfonate Usage And Synthesis |
| Conductivity | 9.84 mS/cm | | Chemical Properties | Colorless liquid | | Uses | Recently used in the preparation of hydrophobic, highly conductive ambient-temperature molten salts, and in the preparation of dual intercalating molten electrolyte batteries. | | Uses | 1-Ethyl-3-methylimidazolium trifluoromethanesulfonate may be used as a solvent to produce ionic polymer-polymer composites (IP2C) and also in lipase-catalyzed enantioselective amine acylation with 4-pentenoic acid. |
| | 1-Ethyl-3-methylimidazolium trifluoromethanesulfonate Preparation Products And Raw materials |
|