| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(R)-2-(Boc-aMino)-5-hexynoic acid
CAS:1217464-82-8
Purity:>=96% (HPLC) Package:250MG
|
| Company Name: |
Wuhan Chemwish Technology Co., Ltd
|
| Tel: |
86-027-67849912 |
| Email: |
sales@chemwish.com |
| Products Intro: |
Product Name:Boc-4-hydroxy-D-phenylglycine
CAS:1217464-82-8
Package:500Mg;1g;5g;25g;100g
|
|
| | BOC-4-HYDROXY-D-PHENYLGLYCINE Basic information |
| | BOC-4-HYDROXY-D-PHENYLGLYCINE Chemical Properties |
| Melting point | >181°C (dec.) | | Boiling point | 380.3±37.0 °C(Predicted) | | density | 1.129±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Ethanol (Slightly) | | pka | 3.84±0.10(Predicted) | | form | Solid | | color | Off-White | | Optical Rotation | [α]/D 80.0±2.0°, c = 1 in DMF | | Stability: | Hygroscopic | | Major Application | peptide synthesis | | InChI | 1S/C11H17NO4/c1-5-6-7-8(9(13)14)12-10(15)16-11(2,3)4/h1,8H,6-7H2,2-4H3,(H,12,15)(H,13,14)/t8-/m1/s1 | | InChIKey | DPHIBCOGEUVKGB-MRVPVSSYSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CCC#C)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 9999999999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | BOC-4-HYDROXY-D-PHENYLGLYCINE Usage And Synthesis |
| Uses | BOC-4-Hydroxy-D-Phenylglycine is an analog of Proctolin as well as the preparation of new cephem derivatives as antibacterial agents, specifically against Helicobacter Pylori. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis
reaction type: click chemistry |
| | BOC-4-HYDROXY-D-PHENYLGLYCINE Preparation Products And Raw materials |
|