|
|
| | 4-Bromo-2-methylbenzonitrile Basic information |
| | 4-Bromo-2-methylbenzonitrile Chemical Properties |
| Melting point | 65-69 °C | | Boiling point | 228.5°C (rough estimate) | | density | 1.5466 (rough estimate) | | refractive index | 1.6550 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystaline | | color | White to Light yellow | | Water Solubility | insoluble | | BRN | 2574103 | | InChI | InChI=1S/C8H6BrN/c1-6-4-8(9)3-2-7(6)5-10/h2-4H,1H3 | | InChIKey | LPEBMDFRIKYFCF-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(Br)C=C1C | | CAS DataBase Reference | 67832-11-5(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Bromo-2-methylbenzonitrile(67832-11-5) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-20/21/22 | | Safety Statements | 36/37/39-26-22-37/39 | | RIDADR | 3439 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-Bromo-2-methylbenzonitrile Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder |
| | 4-Bromo-2-methylbenzonitrile Preparation Products And Raw materials |
|