|
|
| | 2'-Deoxycytidine-5'-triphosphoric acid disodium salt Basic information |
| | 2'-Deoxycytidine-5'-triphosphoric acid disodium salt Chemical Properties |
| Melting point | >0°C | | storage temp. | -20°C | | solubility | Water (Slightly) | | form | aqueous solution | | color | colorless | | biological source | synthetic (organic) | | Water Solubility | Soluble in water. | | Stability: | Hygroscopic | | InChIKey | ABWVCNMFYVEBIB-CDNBRZBRSA-L | | SMILES | O=C1N=C(N)C=CN1[C@H]1C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1.[NaH] |&1:8,10,12,r| | | CAS DataBase Reference | 102783-51-7(CAS DataBase Reference) |
| | 2'-Deoxycytidine-5'-triphosphoric acid disodium salt Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 2'-Deoxycytidine-5'-triphosphoric acid disodium salt is a metabolite of 2’Deoxycytidine. A nucleoside triphosphate that is used whenever DNA is synthesized, such as in the polymerase chain reaction. | | Uses | 2′-Deoxycytidine 5′-triphosphate disodium salt is one of the nucleoside triphosphates used for DNA polymerase driven reactions such as polymerase chain reaction, DNA sequencing and other molecular biology methods. | | Uses | 2'-Deoxycytidine 5'-triphosphate disodium salt is a nucleoside triphosphatase used for DNA synthesis with DNA polymerases and reverse transcriptases. 2-Deoxycytidine 5-triphosphate disodium salt is one of the nucleoside triphosphates used for DNA polymerase driven reactions such as polymerase chain reaction, DNA sequencing and other molecular biology methods. | | General Description | dCTP, PCR Grade, is a 100 mM clear colorless solution of the sodium salt (pH 8.3). PCR Grade nucleotides from Roche are specially manufactured and purified to the highest possible chemical purity. PCR Grade nucleotides contain at least 99% of the relevant deoxynucleoside-triphosphate (dNTP) and less than 0.9% deoxynucleoside-diphosphate (dNDP). | | Biochem/physiol Actions | 2′-Deoxycytidine 5′-triphosphate (dCTP) is used to synthesize DNA by DNA polymerases or reverse transcriptases. dCTP is an allosteric regulator of deoxycytidylate (dCMP) deaminase. It is used in studies of nucleotide pools, nucleotide selectivity and enzyme specificity studies, such as the preferred incorporation of dCTP by Rev1, a γ-family DNA polymerase. |
| | 2'-Deoxycytidine-5'-triphosphoric acid disodium salt Preparation Products And Raw materials |
|