|
|
| | 2,4,6-Triisopropylbenzene-sulfonyl azide Basic information |
| Product Name: | 2,4,6-Triisopropylbenzene-sulfonyl azide | | Synonyms: | 2,4,6-Triisopropylbenzenesulphonylazide;Trisyl azide;2,4,6-Triisopropylbenzenesulfonyl azide, 98%, stab. with ca 10% water;2,4,6-Triisopropylbenzenesulfonyl azide ,90% [stab. With ca 10% water];2,4,6-Triisopropylbenzenesulfonic acid azide;2,4,6-Triisopropylbe;2,4,6-Triisopropylp henylsulfonyl azide;2,4,6-Tris(1-methylethyl)-benzenesulfonyl azide | | CAS: | 36982-84-0 | | MF: | C15H23N3O2S | | MW: | 309.43 | | EINECS: | | | Product Categories: | Azidation/Diazo Transfer;C-X Bond Formation (Non-Halogen);Various Azides;Azides;Building Blocks;Chemical Synthesis;Nitrogen Compounds;Organic Building Blocks;Synthetic Reagents | | Mol File: | 36982-84-0.mol |  |
| | 2,4,6-Triisopropylbenzene-sulfonyl azide Chemical Properties |
| Melting point | 39-44 °C | | refractive index | n20/D1.499 | | Fp | 4℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | Insoluble in water. | | BRN | 2391566 | | InChI | InChI=1S/C15H23N3O2S/c1-9(2)12-7-13(10(3)4)15(14(8-12)11(5)6)21(19,20)18-17-16/h7-11H,1-6H3 | | InChIKey | AEMWUHCKKDPRSK-UHFFFAOYSA-N | | SMILES | S(C1C(=CC(C(C)C)=CC=1C(C)C)C(C)C)(=O)(=O)N=[N+]=[N-] | | CAS DataBase Reference | 36982-84-0(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2,4,6-Triisopropylbenzene-sulfonyl azide Usage And Synthesis |
| Chemical Properties | White wet solid | | Uses | 2,4,6-Triisopropylbenzenesulfonyl azide is used as a reagent for diazo transfer to ketones, e.g. under phase-transfer conditions, giving better yields of sterically-hindered ?-diazo ketones than other methods. It is also used for azide transfer to potassium enolates (KHMDS) to form the ?-azido derivatives. | | Uses | Reagent for:• ;Stereoselective diversity-oriented synthesis of functionalized saccharides1• ;Meyer′s lactamization2Reagent for synthesis of:• ;Antidote to anthrax lethal factor intoxication3• ;Bacterial RNA polymerase inhibitor4• ;Bicyclic extended dipeptide surrogates5• ;Single enantiomers of mycobacterial keomycolic acids6 | | Preparation | 2,4,6-Triisopropylbenzene-sulfonyl azide is readily prepared by treatment of the commercially available triisopropylbenzenesulfonyl chloride (trisyl
chloride) with sodium azide.[1] | | References | 1. Leffler, J. E.; Tsuno, Y. JOC 1962, 28, 902. |
| | 2,4,6-Triisopropylbenzene-sulfonyl azide Preparation Products And Raw materials |
|