|
|
| | Dimethyl-[2-oxo-2-(cyclohexyl-d11)ethyl]phosphonate Basic information |
| | Dimethyl-[2-oxo-2-(cyclohexyl-d11)ethyl]phosphonate Chemical Properties |
| InChI | 1S/C10H19O4P/c1-13-15(12,14-2)8-10(11)9-6-4-3-5-7-9/h9H,3-8H2,1-2H3/i3D2,4D2,5D2,6D2,7D2,9D | | InChIKey | FTZNMXSYERMMBC-QFAYMVOLSA-N | | SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])(C(=O)CP(=O)(OC)OC)C([2H])([2H])C1([2H])[2H] |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | Dimethyl-[2-oxo-2-(cyclohexyl-d11)ethyl]phosphonate Usage And Synthesis |
| Uses | (2-Cyclohexyl-2-oxoethyl)phosphonic Acid Dimethyl Ester-d11 is an intermediate in synthesizing NLG919-d10 (N630002). It is a isotope labelled analog of NLG919 (N630000). NLG919 is a potent indoleamine-2,3-dioxygenase (IDO) pathway inhibitor and is suitable for the treatment of immunosuppression associated with cancer. | | reaction suitability | reaction type: C-C Bond Formation |
| | Dimethyl-[2-oxo-2-(cyclohexyl-d11)ethyl]phosphonate Preparation Products And Raw materials |
|