|
|
| | 4-FORMYL-3-HYDROXYBENZOIC ACID Basic information |
| | 4-FORMYL-3-HYDROXYBENZOIC ACID Chemical Properties |
| Melting point | 235-240 °C (lit.) | | Boiling point | 214.32°C (rough estimate) | | density | 1.2208 (rough estimate) | | refractive index | 1.4611 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 3.66±0.10(Predicted) | | form | solid | | Appearance | White to light brown Solid | | InChI | InChI=1S/C8H6O4/c9-4-6-2-1-5(8(11)12)3-7(6)10/h1-4,10H,(H,11,12) | | InChIKey | FDDHFCWYCKQKGY-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(C=O)C(O)=C1 |
| Hazard Codes | Xn | | Risk Statements | 22-36/38-43 | | Safety Statements | 26-36 | | WGK Germany | 2 | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | 4-FORMYL-3-HYDROXYBENZOIC ACID Usage And Synthesis |
| Uses | 4-Formyl-3-hydroxybenzoic acid can be used as a reactant to prepare:
- A pH-sensitive fluorescent probe 4,4′-(hydrazine-1,2-diylidene bis(methanylylidene)) bis(3-hydroxybenzoic acid (HDBB) by one-step condensation reaction with hydrazine.
- 2-Oxo-2H-1-benzopyran-3,7-dicarboxylic acid by condensation reaction with diethyl malonate.
- Schiff base ligands for the preparation of stable and functional Schiff base metal complexes.
| | Synthesis | GENERAL METHOD: Hexamethylenetetramine (0.3 mmol) and cuprous oxide (0.15 mmol) were sequentially added to a solution of trifluoroacetic acid (5 mL) of the substrate (1a-1q, 0.15 mmol). The reaction mixture was heated to reflux for 5 h and subsequently cooled to room temperature. 3N hydrochloric acid (5 mL) was slowly added to the reaction system and stirring was continued for 1 hour. Upon completion of the reaction, the mixture was concentrated under reduced pressure to remove the solvent. The crude product was purified by silica gel column chromatography (200-300 mesh) to afford the target compound 4-formyl-3-hydroxybenzoic acid. | | References | [1] Research on Chemical Intermediates, 2015, vol. 41, # 11, p. 8147 - 8158 |
| | 4-FORMYL-3-HYDROXYBENZOIC ACID Preparation Products And Raw materials |
|